loading...| Preferred Name | azathioprine | |
| Synonyms |
Imuran (TN) 6-(1'-Methyl-4'-nitro-5'-imidazolyl)-mercaptopurine 6-((1-Methyl-4-nitro-1H-imidazol-5-yl)thio)-1H-purine 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-7H-purine |
|
| Definitions |
A thiopurine that is 6-mercaptopurine in which the mercapto hydrogen is replaced by a 1-methyl-4-nitroimidazol-5-yl group. It is a prodrug for mercaptopurine and is used as an immunosuppressant, prescribed for the treatment of inflammatory conditions and after organ transplantation and also for treatment of Crohn's didease and MS. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2948 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16344342 PMID:18008354 PMID:15973722 PMID:8738760 Wikipedia:Azathioprine SNOMEDCT:372574004 KEGG:D00238 PMID:25581826 PMID:16764353 PMID:18336531 PMID:16397313 ChemIDplus:446-86-6 KEGG:C06837 PMID:17381669 Drug_Central:269 DrugBank:DB00993 PMID:25641386 PMID:11064448 KEGG DRUG:446-86-6 PMID:15199672 CAS:446-86-6 KEGG DRUG:D00238 PMID:9345422 PMID:25314066 PMID:19243907 PMID:9273463 Reaxys:1225351 PMID:17970886 PMID:15476481 ChEMBL:531141 PMID:25443086 MeSH:D001379 PMID:28166217 PMID:25248004 PMID:16954801 PMID:15628319 PMID:25440430 PMID:20080917 SNOMEDCT:111165009 NCIt:C290 |
|
| definition |
A thiopurine that is 6-mercaptopurine in which the mercapto hydrogen is replaced by a 1-methyl-4-nitroimidazol-5-yl group. It is a prodrug for mercaptopurine and is used as an immunosuppressant, prescribed for the treatment of inflammatory conditions and after organ transplantation and also for treatment of Crohn's didease and MS. |
|
| formula |
C9H7N7O2S |
|
| has characteristic | ||
| has_exact_synonym |
6-[(1-methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-7H-purine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Imuran (TN) 6-(1'-Methyl-4'-nitro-5'-imidazolyl)-mercaptopurine 6-((1-Methyl-4-nitro-1H-imidazol-5-yl)thio)-1H-purine |
|
| has_role | ||
| id |
CHEBI:2948 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H7N7O2S/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8/h2-4H,1H3,(H,10,11,12,13) |
|
| inchikey |
LMEKQMALGUDUQG-UHFFFAOYSA-N |
|
| label |
azathioprine |
|
| mass |
277.26386 |
|
| monoisotopicmass |
277.03819 |
|
| notation |
CHEBI:2948 |
|
| preferred label |
azathioprine |
|
| prefLabel |
azathioprine |
|
| smiles |
Cn1cnc(c1Sc1ncnc2nc[nH]c12)[N+]([O-])=O |
|
| subClassOf |