Preferred Name |
theobromine |
|
Synonyms |
3,7-Dimethylxanthine 3,7-dihydro-3,7-dimethyl-1H-purine-2,6-dione Theobromin 3,7-dimethylxanthine 3,7-dimethylpurine-2,6-dione theobromine Theobromine THEOBROMINE 3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
|
Definitions |
A dimethylxanthine having the two methyl groups located at positions 3 and 7. A purine alkaloid derived from the cacao plant, it is found in chocolate, as well as in a number of other foods, and is a vasodilator, diuretic and heart stimulator. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28946 |
|
charge |
0 |
|
database_cross_reference |
PMID:9468592 LINCS:LSM-5483 PMID:22866022 MetaCyc:3-7-DIMETHYLXANTHINE DrugBank:DB01412 KEGG:C07480 PMID:28166217 PMID:22770225 PMID:22751681 Drug_Central:2618 Reaxys:16464 PMID:18632476 Wikipedia:Theobromine PMID:21871761 KNApSAcK:C00001509 PMID:18964243 PMID:11600064 PMID:23094271 Gmelin:143367 CAS:83-67-0 PMID:16979558 HMDB:HMDB0002825 Beilstein:16464 PMID:23236361 PMID:19018565 PDBeChem:37T PMID:21839757 PMID:22824731 PMID:10456233 |
|
definition |
A dimethylxanthine having the two methyl groups located at positions 3 and 7. A purine alkaloid derived from the cacao plant, it is found in chocolate, as well as in a number of other foods, and is a vasodilator, diuretic and heart stimulator. |
|
formula |
C7H8N4O2 |
|
has_alternative_id |
CHEBI:39914 CHEBI:9521 CHEBI:26939 |
|
has_exact_synonym |
theobromine Theobromine THEOBROMINE 3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3,7-Dimethylxanthine 3,7-dihydro-3,7-dimethyl-1H-purine-2,6-dione Theobromin 3,7-dimethylxanthine 3,7-dimethylpurine-2,6-dione |
|
id |
CHEBI:28946 |
|
in_subset | ||
inchi |
InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
|
inchikey |
YAPQBXQYLJRXSA-UHFFFAOYSA-N |
|
label |
theobromine |
|
mass |
180.16418 |
|
monoisotopicmass |
180.06473 |
|
notation |
CHEBI:28946 |
|
preferred label |
theobromine |
|
prefLabel |
theobromine |
|
smiles |
Cn1cnc2n(C)c(=O)[nH]c(=O)c12 |
|
subClassOf |