Preferred Name |
dehydroepiandrosterone |
|
Synonyms |
Dehydroisoandrosterone 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE Prasterone DHEA 3beta-Hydroxyandrost-5-en-17-one DHA Intrarosa 3beta-hydroxyandrost-5-en-17-one Dehydroepiandrosterone |
|
Definitions |
An androstanoid that is androst-5-ene substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. It is a naturally occurring steroid hormone produced by the adrenal glands. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28689 |
|
charge |
0 |
|
database_cross_reference |
MeSH:D003687 SNOMEDCT:78316004 NCIt:C2265 PDBeChem:AND PMID:18634257 PMID:24424045 PMID:14662261 PMID:24256992 HMDB:HMDB0000077 Reaxys:2058110 KEGG:D08409 DrugBank:DB01708 LIPID_MAPS_instance:LMST02020021 KEGG:C01227 Wikipedia:Dehydroepiandrosterone Drug_Central:795 MetaCyc:3-BETA-HYDROXYANDROST-5-EN-17-ONE CAS:53-43-0 |
|
definition |
An androstanoid that is androst-5-ene substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. It is a naturally occurring steroid hormone produced by the adrenal glands. |
|
formula |
C19H28O2 |
|
has_alternative_id |
CHEBI:86953 CHEBI:20246 CHEBI:11911 CHEBI:40738 CHEBI:1723 |
|
has_exact_synonym |
Dehydroepiandrosterone 3beta-hydroxyandrost-5-en-17-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dehydroisoandrosterone 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE Prasterone DHEA 3beta-Hydroxyandrost-5-en-17-one DHA Intrarosa 3beta-hydroxyandrost-5-en-17-one |
|
id |
CHEBI:28689 |
|
in_subset | ||
inchi |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20H,4-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1 |
|
inchikey |
FMGSKLZLMKYGDP-USOAJAOKSA-N |
|
label |
dehydroepiandrosterone |
|
mass |
288.42440 |
|
monoisotopicmass |
288.20893 |
|
notation |
CHEBI:28689 |
|
preferred label |
dehydroepiandrosterone |
|
prefLabel |
dehydroepiandrosterone |
|
smiles |
[H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
|
subClassOf |