loading...| Preferred Name | isoflavone | |
| Synonyms |
3-Phenylchromone 3-phenyl-4H-1-benzopyran-4-one Isoflavon 3-phenyl-4H-chromen-4-one Isoflavone |
|
| Definitions |
A simplest member of the class of isoflavones that is 4H-chromen-4-one in which the hydrogen at position 3 is replaced by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18220 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:157731 KEGG:C00799 Beilstein:157731 Gmelin:1224833 LIPID_MAPS_instance:LMPK12050000 CAS:574-12-9 |
|
| definition |
A simplest member of the class of isoflavones that is 4H-chromen-4-one in which the hydrogen at position 3 is replaced by a phenyl group. |
|
| formula |
C15H10O2 |
|
| has_alternative_id |
CHEBI:14467 CHEBI:24892 CHEBI:6013 |
|
| has_exact_synonym |
3-phenyl-4H-chromen-4-one Isoflavone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-Phenylchromone 3-phenyl-4H-1-benzopyran-4-one Isoflavon |
|
| id |
CHEBI:18220 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H |
|
| inchikey |
GOMNOOKGLZYEJT-UHFFFAOYSA-N |
|
| label |
isoflavone |
|
| mass |
222.23870 |
|
| monoisotopicmass |
222.06808 |
|
| notation |
CHEBI:18220 |
|
| preferred label |
isoflavone |
|
| prefLabel |
isoflavone |
|
| smiles |
O=c1c(coc2ccccc12)-c1ccccc1 |
|
| subClassOf |