Preferred Name |
acyclovir |
|
Synonyms |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one acycloguanosine aciclovirum Zovir aciclovir |
|
Definitions |
An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. Used in the treatment of viral infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2453 |
|
charge |
0 |
|
database_cross_reference |
PMID:24346595 KEGG:C06810 Drug_Central:85 PMID:11687127 PMID:11994034 Wikipedia:Acyclovir PMID:26024233 KEGG:D00222 CAS:59277-89-3 HMDB:HMDB0014925 Patent:DE2539963 DrugBank:DB00787 PDBeChem:AC2 Beilstein:1219402 Reaxys:1219402 PMID:28166217 LINCS:LSM-5459 Patent:US4199574 PMID:8308511 |
|
definition |
An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. Used in the treatment of viral infections. |
|
formula |
C8H11N5O3 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:40459 |
|
has_exact_synonym |
2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acycloguanosine aciclovirum Zovir aciclovir |
|
has_RxCUI |
281 |
|
id |
CHEBI:2453 |
|
in_subset | ||
inchi |
InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
|
inchikey |
MKUXAQIIEYXACX-UHFFFAOYSA-N |
|
label |
Acyclovir acyclovir |
|
mass |
225.20460 |
|
monoisotopicmass |
225.08619 |
|
notation |
CHEBI:2453 |
|
prefLabel |
acyclovir |
|
smiles |
Nc1nc2n(COCCO)cnc2c(=O)[nH]1 |
|
subClassOf |