loading...| Preferred Name |
Ticlopidine |
|
| Synonyms |
5-(2-chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine ticlopidina ticlopidine ticlopidinum |
|
| Definitions |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9588 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-1986 PMID:19180126 Patent:DE2404308 Patent:US4127580 Patent:US4051141 KEGG:D08594 Drug_Central:2657 DrugBank:DB00208 CAS:55142-85-3 KEGG:C07140 Wikipedia:Ticlopidine Reaxys:1216802 |
|
| definition |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group. |
|
| formula |
C14H14ClNS |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50249 http://purl.obolibrary.org/obo/CHEBI_50427 |
|
| has_exact_synonym |
5-(2-chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ticlopidina ticlopidine ticlopidinum |
|
| has_RxCUI |
10594 |
|
| id |
CHEBI:9588 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2 |
|
| inchikey |
PHWBOXQYWZNQIN-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
Ticlopidine ticlopidine |
|
| mass |
263.78600 |
|
| monoisotopicmass |
263.05355 |
|
| notation |
CHEBI:9588 |
|
| prefLabel |
Ticlopidine |
|
| smiles |
Clc1ccccc1CN1CCc2sccc2C1 |
|
| subClassOf |