loading...| Preferred Name |
peramivir |
|
| Synonyms |
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-carbamimidamido-2-hydroxycyclopentane-1-carboxylic acid 3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid BCX 1812 BCX-1812 BCX1812 RWJ 270201 RWJ-270201 RWJ270201 |
|
| Definitions |
A member of the class of guanidines that is used (as its trihydrate) for the treatment of acute uncomplicated influenza in patients 18 years and older who have been symptomatic for no more than two days. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_85202 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:330600-85-6 PMID:25523716 PMID:25547357 PMID:25277670 Wikipedia:Peramivir PMID:25752738 PMID:24517996 PMID:25697190 Drug_Central:4823 Reaxys:9011170 PDBeChem:BCZ PMID:25231091 PMID:25691635 |
|
| definition |
A member of the class of guanidines that is used (as its trihydrate) for the treatment of acute uncomplicated influenza in patients 18 years and older who have been symptomatic for no more than two days. |
|
| formula |
C15H28N4O4 |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:41095 |
|
| has_exact_synonym |
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-carbamimidamido-2-hydroxycyclopentane-1-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(1'-acetylamino-2'-ethyl)butyl-4-((aminoimino)methyl)amino-2-hydroxycyclopentane-1-carboxylic acid BCX 1812 BCX-1812 BCX1812 RWJ 270201 RWJ-270201 RWJ270201 |
|
| has_RxCUI |
619693 |
|
| id |
CHEBI:85202 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H28N4O4/c1-4-8(5-2)12(18-7(3)20)11-10(19-15(16)17)6-9(13(11)21)14(22)23/h8-13,21H,4-6H2,1-3H3,(H,18,20)(H,22,23)(H4,16,17,19)/t9-,10+,11+,12-,13+/m0/s1 |
|
| inchikey |
XRQDFNLINLXZLB-CKIKVBCHSA-N |
|
| label |
peramivir |
|
| mass |
328.40720 |
|
| monoisotopicmass |
328.21106 |
|
| notation |
CHEBI:85202 |
|
| prefLabel |
peramivir |
|
| smiles |
CCC(CC)[C@H](NC(C)=O)[C@@H]1[C@H](O)[C@H](C[C@H]1NC(N)=N)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22160 http://purl.obolibrary.org/obo/CHEBI_24436 |