Preferred Name |
isopropyl palmitate |
|
Synonyms |
isopropyl hexadecanoate palmitic acid isopropyl ester isopropyl n-hexadecanoate 1-methylethyl hexadecanoate propan-2-yl hexadecanoate |
|
Definitions |
A fatty acid ester obtained by the formal condensation of carboxy group of palmitic acid with propan-2-ol. Metabolite observed in cancer metabolism. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84262 |
|
alternative label |
isopropyl hexadecanoate palmitic acid isopropyl ester isopropyl n-hexadecanoate 1-methylethyl hexadecanoate propan-2-yl hexadecanoate |
|
charge |
0 |
|
database_cross_reference |
LIPID_MAPS_instance:LMFA07010675 KEGG:D04632 Reaxys:1786567 Wikipedia:Isopropyl_palmitate PMID:25272650 CAS:142-91-6 HMDB:HMDB0035474 PMID:25518943 |
|
definition |
A fatty acid ester obtained by the formal condensation of carboxy group of palmitic acid with propan-2-ol. Metabolite observed in cancer metabolism. |
|
formula |
C19H38O2 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
propan-2-yl hexadecanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
isopropyl hexadecanoate palmitic acid isopropyl ester isopropyl n-hexadecanoate 1-methylethyl hexadecanoate |
|
has_RxCUI |
1311179 |
|
id |
CHEBI:84262 |
|
in_subset | ||
inchi |
InChI=1S/C19H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)21-18(2)3/h18H,4-17H2,1-3H3 |
|
inchikey |
XUGNVMKQXJXZCD-UHFFFAOYSA-N |
|
label |
isopropyl palmitate |
|
mass |
298.50380 |
|
monoisotopicmass |
298.28718 |
|
notation |
CHEBI:84262 |
|
prefLabel |
isopropyl palmitate |
|
smiles |
CCCCCCCCCCCCCCCC(=O)OC(C)C |
|
subClassOf |