Preferred Name |
O-desmethylvenlafaxine |
|
Synonyms |
4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol 1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexanol desvenlafaxine |
|
Definitions |
A tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-hydroxyphenyl group. It is a metabolite of the drug venlafaxine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_83527 |
|
charge |
0 |
|
database_cross_reference |
PMID:25188033 Reaxys:4234613 PMID:25086830 Wikipedia:Desvenlafaxine PMID:24502274 Drug_Central:4380 KEGG:D07793 PMID:24989434 HMDB:HMDB0015646 DrugBank:DB06700 CAS:93413-62-8 PMID:24493333 |
|
definition |
A tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-hydroxyphenyl group. It is a metabolite of the drug venlafaxine. |
|
formula |
C16H25NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_49103 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol 1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexanol desvenlafaxine |
|
has_RxCUI |
734064 |
|
id |
CHEBI:83527 |
|
in_subset | ||
inchi |
InChI=1S/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3 |
|
inchikey |
KYYIDSXMWOZKMP-UHFFFAOYSA-N |
|
label |
Desvenlafaxine O-desmethylvenlafaxine |
|
mass |
263.37520 |
|
monoisotopicmass |
263.18853 |
|
notation |
CHEBI:83527 |
|
prefLabel |
O-desmethylvenlafaxine |
|
smiles |
CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/OBI_0000047 |