loading...| Preferred Name | tropolone | |
| Synonyms |
2-hydroxycyclohepta-2,4,6-trienone purpurocatechol 2-hydroxytropone 2-hydroxy-2,4,6-cycloheptatrien-1-one 2-hydroxycyclohepta-2,4,6-trien-1-one |
|
| Definitions |
A cyclic ketone that is cyclohepta-2,4,6-trien-1-one substituted by a hydroxy group at position 2. It is a toxin produced by the agricultural pathogen Burkholderia plantarii. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_79966 |
|
| alternative label |
2-hydroxycyclohepta-2,4,6-trienone purpurocatechol 2-hydroxytropone 2-hydroxy-2,4,6-cycloheptatrien-1-one 2-hydroxycyclohepta-2,4,6-trien-1-one |
|
| charge |
0 |
|
| database_cross_reference |
PMID:28661582 PMID:30677202 PMID:31452043 PMID:21598903 PMID:1847521 PMID:28389830 PDBeChem:0TR PMID:27002128 PMID:27908108 CAS:533-75-5 PMID:31907180 KEGG:C15474 PMID:11561410 PMID:30549082 Wikipedia:Tropolone PMID:31820778 PMID:29589436 MetaCyc:CPD-7024 Reaxys:1904978 |
|
| definition |
A cyclic ketone that is cyclohepta-2,4,6-trien-1-one substituted by a hydroxy group at position 2. It is a toxin produced by the agricultural pathogen Burkholderia plantarii. |
|
| formula |
C7H6O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_24127 |
|
| has_exact_synonym |
2-hydroxycyclohepta-2,4,6-trien-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-hydroxycyclohepta-2,4,6-trienone purpurocatechol 2-hydroxytropone 2-hydroxy-2,4,6-cycloheptatrien-1-one |
|
| has_RxCUI |
1368873 |
|
| id |
CHEBI:79966 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H6O2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H,8,9) |
|
| inchikey |
MDYOLVRUBBJPFM-UHFFFAOYSA-N |
|
| label |
tropolone |
|
| mass |
122.123 |
|
| monoisotopicmass |
122.03678 |
|
| notation |
CHEBI:79966 |
|
| prefLabel |
tropolone |
|
| smiles |
OC1=CC=CC=CC1=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139588 |