loading...| Preferred Name | hexadecanoate | |
| Synonyms |
Hexadecanoic acid, ion(1-) 1-hexyldecanoate CH3-[CH2]14-COO(-) pentadecanecarboxylate n-hexadecanoate 1-pentadecanecarboxylate n-hexadecoate (16:0) palmitate hexadecanoate |
|
| Definitions |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7896 |
|
| alternative label |
Hexadecanoic acid, ion(1-) 1-hexyldecanoate CH3-[CH2]14-COO(-) pentadecanecarboxylate n-hexadecanoate 1-pentadecanecarboxylate n-hexadecoate (16:0) palmitate hexadecanoate |
|
| charge |
-1 |
|
| database_cross_reference |
Reaxys:3589907 HMDB:HMDB0000220 MetaCyc:PALMITATE CAS:143-20-4 Gmelin:344266 Beilstein:3589907 |
|
| definition |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
| formula |
C16H31O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:231736 |
|
| has_exact_synonym |
hexadecanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Hexadecanoic acid, ion(1-) 1-hexyldecanoate CH3-[CH2]14-COO(-) pentadecanecarboxylate n-hexadecanoate 1-pentadecanecarboxylate n-hexadecoate (16:0) palmitate |
|
| id |
CHEBI:7896 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 |
|
| inchikey |
IPCSVZSSVZVIGE-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
hexadecanoate |
|
| mass |
255.41610 |
|
| monoisotopicmass |
255.23295 |
|
| notation |
CHEBI:7896 |
|
| prefLabel |
hexadecanoate |
|
| smiles |
CCCCCCCCCCCCCCCC([O-])=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78123 http://purl.obolibrary.org/obo/CHEBI_76619 |