Preferred Name |
Nizatidine |
|
Synonyms |
N-{2-[({2-[(dimethylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine N-(4-(6-Methylamino-7-nitro-2-thia-5-aza-6-hepten-1-yl)-2-thiazolylmethyl)-N,N-dimethylamine nizatidinum Acinon Axid nizatidina nizatidine |
|
Definitions |
A member of the class of 1,3-thiazoles having a dimethylaminomethyl substituent at position 2 and an alkylthiomethyl moiety at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7601 |
|
charge |
0 |
|
database_cross_reference |
PMID:23836529 PMID:23556039 PMID:24375669 PMID:23611167 Wikipedia:Nizatidine PMID:22374468 PMID:20435237 DrugBank:DB00585 KEGG:D00440 PMID:24253609 KEGG:C07270 LINCS:LSM-3031 Drug_Central:1955 PMID:24601855 Reaxys:4846056 HMDB:HMDB0014723 PMID:21858296 PMID:20881754 CAS:76963-41-2 PMID:12520631 PMID:22846371 |
|
definition |
A member of the class of 1,3-thiazoles having a dimethylaminomethyl substituent at position 2 and an alkylthiomethyl moiety at position 4. |
|
formula |
C12H21N5O2S2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38323 |
|
has_exact_synonym |
N-{2-[({2-[(dimethylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-(4-(6-Methylamino-7-nitro-2-thia-5-aza-6-hepten-1-yl)-2-thiazolylmethyl)-N,N-dimethylamine nizatidinum Acinon Axid nizatidina nizatidine |
|
has_RxCUI |
42319 |
|
id |
CHEBI:7601 |
|
in_subset | ||
inchi |
InChI=1S/C12H21N5O2S2/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3/h6,9,13-14H,4-5,7-8H2,1-3H3 |
|
inchikey |
SGXXNSQHWDMGGP-UHFFFAOYSA-N |
|
label |
Nizatidine nizatidine |
|
mass |
331.45700 |
|
monoisotopicmass |
331.11367 |
|
notation |
CHEBI:7601 |
|
prefLabel |
Nizatidine |
|
smiles |
CNC(NCCSCc1csc(CN(C)C)n1)=C[N+]([O-])=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_16385 http://purl.obolibrary.org/obo/CHEBI_38418 http://purl.obolibrary.org/obo/CHEBI_35359 |