loading...| Preferred Name |
Aminacrine |
|
| Synonyms |
9-acridinamine aminoacridine aminoacridina aminoacridinum 10-amino-5-azaanthracene 5-aminoacridine 9AA aminacrin aminacrine acridin-9-amine |
|
| Definitions |
An aminoacridine that is acridine in which the hydrogen at position 9 is replaced by an amino group. A fluorescent dyd and topical antiseptic agent, it is used (usually as the hydrochloride salt) in eye drops for the treatment of superficial eye infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74789 |
|
| alternative label |
9-acridinamine aminoacridine aminoacridina aminoacridinum 10-amino-5-azaanthracene 5-aminoacridine 9AA aminacrin aminacrine acridin-9-amine |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:141171 CAS:90-45-9 PMID:22477060 LINCS:LSM-15516 Wikipedia:9-Aminoacridine PMID:23257326 PMID:24341665 Drug_Central:160 |
|
| definition |
An aminoacridine that is acridine in which the hydrogen at position 9 is replaced by an amino group. A fluorescent dyd and topical antiseptic agent, it is used (usually as the hydrochloride salt) in eye drops for the treatment of superficial eye infections. |
|
| formula |
C13H10N2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_64345 http://purl.obolibrary.org/obo/CHEBI_25435 http://purl.obolibrary.org/obo/CHEBI_48218 |
|
| has_exact_synonym |
acridin-9-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
9-acridinamine aminoacridine aminoacridina aminoacridinum 10-amino-5-azaanthracene 5-aminoacridine 9AA aminacrin aminacrine |
|
| has_RxCUI |
645 |
|
| id |
CHEBI:74789 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15) |
|
| inchikey |
XJGFWWJLMVZSIG-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
9-aminoacridine Aminacrine |
|
| mass |
194.23190 |
|
| monoisotopicmass |
194.08440 |
|
| notation |
CHEBI:74789 |
|
| prefLabel |
Aminacrine |
|
| smiles |
Nc1c2ccccc2nc2ccccc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51803 |