loading...| Preferred Name |
Clioquinol |
|
| Synonyms |
5-chloro-7-iodoquinolin-8-ol iodochlorhydroxyquinoline iodochloroxyquinoline 5-chloro-8-hydroxy-7-iodoquinoline 7-iodo-5-chloro-8-hydroxyquinoline 5-chloro-7-iodo-8-hydroxyquinoline 5-chloro-7-iodo-8-quinolinol iodochlorohydroxyquin 5-Chlor-7-jod-8-hydroxy-chinolin clioquinolum 7-iodo-5-chloroxine chloroiodoquin clioquinol |
|
| Definitions |
A monohydroxyquinoline that is quinolin-8-ol in which the hydrogens at positions 5 and 7 are replaced by chlorine and iodine, respectively. It has antibacterial and atifungal properties, and is used in creams for the treatment of skin infections. It has also been investigated as a chelator of copper and zinc ions for the possible treatment of Alzheimer's disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74460 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US641491 PMID:21247386 PMID:21199452 Drug_Central:681 PMID:185949 Patent:DE117767 PDBeChem:CQL PMID:23044228 PMID:15074181 PMID:22269164 PMID:15651505 PMID:16087879 PMID:23627708 PMID:21899946 Reaxys:153637 KEGG:D03538 PMID:22627294 PMID:20651355 LINCS:LSM-2186 PMID:21080020 Wikipedia:Clioquinol CAS:130-26-7 PMID:21426304 PMID:226725 PMID:22248233 PMID:23360710 DrugBank:DB04815 |
|
| definition |
A monohydroxyquinoline that is quinolin-8-ol in which the hydrogens at positions 5 and 7 are replaced by chlorine and iodine, respectively. It has antibacterial and atifungal properties, and is used in creams for the treatment of skin infections. It has also been investigated as a chelator of copper and zinc ions for the possible treatment of Alzheimer's disease. |
|
| formula |
C9H5ClINO |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35820 http://purl.obolibrary.org/obo/CHEBI_166831 |
|
| has_exact_synonym |
5-chloro-7-iodoquinolin-8-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
iodochlorhydroxyquinoline iodochloroxyquinoline 5-chloro-8-hydroxy-7-iodoquinoline 7-iodo-5-chloro-8-hydroxyquinoline 5-chloro-7-iodo-8-hydroxyquinoline 5-chloro-7-iodo-8-quinolinol iodochlorohydroxyquin 5-Chlor-7-jod-8-hydroxy-chinolin clioquinolum 7-iodo-5-chloroxine chloroiodoquin clioquinol |
|
| has_RxCUI |
5942 |
|
| id |
CHEBI:74460 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H5ClINO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
|
| inchikey |
QCDFBFJGMNKBDO-UHFFFAOYSA-N |
|
| label |
5-chloro-7-iodoquinolin-8-ol Clioquinol |
|
| mass |
305.50000 |
|
| monoisotopicmass |
304.91044 |
|
| notation |
CHEBI:74460 |
|
| prefLabel |
Clioquinol |
|
| smiles |
Oc1c(I)cc(Cl)c2cccnc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/OBI_0000047 |