Preferred Name |
methyl anthranilate |
|
Synonyms |
Methyl o-aminobenzoate 2-Carbomethoxyaniline Anthranilic acid methyl ester O-methyl anthranilate o-Carbomethoxyaniline 2-(Methoxycarbonyl)aniline 2-Aminobenzoic acid methyl ester o-Aminobenzoic acid methyl ester |
|
Definitions |
A benzoate ester that is the methyl ester of anthranilic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_73244 |
|
charge |
0 |
|
database_cross_reference |
CAS:134-20-3 PMID:22457628 PMID:20519632 PMID:22499556 PMID:21882683 Patent:US2011104099 PMID:19645280 HMDB:HMDB0029703 Wikipedia:Methyl_anthranilate Reaxys:606965 BPDB:1626 |
|
definition |
A benzoate ester that is the methyl ester of anthranilic acid. |
|
formula |
C8H9NO2 |
|
has functional parent | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Methyl o-aminobenzoate 2-Carbomethoxyaniline Anthranilic acid methyl ester O-methyl anthranilate o-Carbomethoxyaniline 2-(Methoxycarbonyl)aniline 2-Aminobenzoic acid methyl ester o-Aminobenzoic acid methyl ester |
|
has_RxCUI |
29742 |
|
id |
CHEBI:73244 |
|
in_subset | ||
inchi |
InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
|
inchikey |
VAMXMNNIEUEQDV-UHFFFAOYSA-N |
|
label |
methyl anthranilate |
|
mass |
151.16260 |
|
monoisotopicmass |
151.06333 |
|
notation |
CHEBI:73244 |
|
prefLabel |
methyl anthranilate |
|
smiles |
COC(=O)c1ccccc1N |
|
subClassOf |