loading...| Preferred Name | cabozantinib | |
| Synonyms |
BMS 907351 BMS-907351 XL 184 XL-184 XL184 N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|
| Definitions |
A dicarboxylic acid diamide that is N-phenyl-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide in which the hydrogen at position 4 on the phenyl ring is substituted by a (6,7-dimethoxyquinolin-4-yl)oxy group. A multi-tyrosine kinase inhibitor, used (as its malate salt) for the treatment of progressive, metastatic, medullary thyroid cancer. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72317 |
|
| alternative label |
BMS 907351 BMS-907351 XL 184 XL-184 XL184 N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21926191 Drug_Central:4715 PMID:23337763 PMID:23337762 Reaxys:18631644 PMID:23169517 PMID:23104465 PMID:23375349 PMID:21460789 PMID:21314233 CAS:849217-68-1 PMID:22146228 PMID:22585997 PMID:23335077 PMID:21613405 PMID:23292257 PMID:23319755 LINCS:LSM-1195 PMID:21606412 Wikipedia:Cabozantinib PMID:23319867 PMID:23248244 PMID:23292795 PMID:20127563 PMID:21860001 PMID:23319797 PMID:21862995 KEGG:D10062 Patent:WO2012109510 |
|
| definition |
A dicarboxylic acid diamide that is N-phenyl-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide in which the hydrogen at position 4 on the phenyl ring is substituted by a (6,7-dimethoxyquinolin-4-yl)oxy group. A multi-tyrosine kinase inhibitor, used (as its malate salt) for the treatment of progressive, metastatic, medullary thyroid cancer. |
|
| formula |
C28H24FN3O5 |
|
| has role | ||
| has_exact_synonym |
N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
BMS 907351 BMS-907351 XL 184 XL-184 XL184 |
|
| has_RxCUI |
1363268 |
|
| id |
CHEBI:72317 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H24FN3O5/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34) |
|
| inchikey |
ONIQOQHATWINJY-UHFFFAOYSA-N |
|
| label |
cabozantinib |
|
| mass |
501.50570 |
|
| monoisotopicmass |
501.17000 |
|
| notation |
CHEBI:72317 |
|
| prefLabel |
cabozantinib |
|
| smiles |
COc1cc2nccc(Oc3ccc(NC(=O)C4(CC4)C(=O)Nc4ccc(F)cc4)cc3)c2cc1OC |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35779 http://purl.obolibrary.org/obo/CHEBI_35618 |