loading...| Preferred Name | lomitapide | |
| Synonyms |
lomitapidum AEGR 733 AEGR 773 AEGR-733 AEGR-773 AEGR733 AEGR773 BMS 201038 BMS-201038 BMS201038 Juxtapid Lojuxta lomitapida lomitapide N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
|
| Definitions |
A member of the class of benzamides obtained by formal condensation of the carboxy group of 4'-(trifluoromethyl)biphenyl-2-carboxylic acid with the primary amino group of 9-[4-(4-aminopiperidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide. Used (as its mesylate salt) as a complement to a low-fat diet and other lipid-lowering treatments in patients with homozygous familial hypercholesterolemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72297 |
|
| alternative label |
lomitapidum AEGR 733 AEGR 773 AEGR-733 AEGR-773 AEGR733 AEGR773 BMS 201038 BMS-201038 BMS201038 Juxtapid Lojuxta lomitapida lomitapide N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
|
| charge |
0 |
|
| database_cross_reference |
PMID:28716835 PMID:25702706 PMID:27232459 Patent:US2012035204 Patent:US2010273829 PMID:23147576 Reaxys:13754976 Drug_Central:4721 DrugBank:DB08827 CAS:182431-12-5 PMID:24366202 PMID:28598687 PMID:17215532 PMID:27785928 Patent:US2011288110 PMID:28239069 PMID:28154305 PMID:21846156 PMID:22963620 Patent:US2008161279 KEGG:D09637 PMID:26686567 Patent:US2012071458 Patent:US2011288064 PMID:26120010 PMID:25257075 PMID:20127562 Patent:US2003162788 PMID:28432645 PMID:23122768 PMID:23122767 PMID:27055957 Wikipedia:Lomitapide PMID:28255870 |
|
| definition |
A member of the class of benzamides obtained by formal condensation of the carboxy group of 4'-(trifluoromethyl)biphenyl-2-carboxylic acid with the primary amino group of 9-[4-(4-aminopiperidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide. Used (as its mesylate salt) as a complement to a low-fat diet and other lipid-lowering treatments in patients with homozygous familial hypercholesterolemia. |
|
| formula |
C39H37F6N3O2 |
|
| has role | ||
| has_exact_synonym |
N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
lomitapidum AEGR 733 AEGR 773 AEGR-733 AEGR-773 AEGR733 AEGR773 BMS 201038 BMS-201038 BMS201038 Juxtapid Lojuxta lomitapida lomitapide |
|
| has_RxCUI |
1364479 |
|
| id |
CHEBI:72297 |
|
| in_subset | ||
| inchi |
InChI=1S/C39H37F6N3O2/c40-38(41,42)25-46-36(50)37(33-13-5-3-10-30(33)31-11-4-6-14-34(31)37)21-7-8-22-48-23-19-28(20-24-48)47-35(49)32-12-2-1-9-29(32)26-15-17-27(18-16-26)39(43,44)45/h1-6,9-18,28H,7-8,19-25H2,(H,46,50)(H,47,49) |
|
| inchikey |
MBBCVAKAJPKAKM-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
lomitapide |
|
| mass |
693.722 |
|
| monoisotopicmass |
693.27900 |
|
| notation |
CHEBI:72297 |
|
| prefLabel |
lomitapide |
|
| smiles |
C1(C(NCC(F)(F)F)=O)(CCCCN2CCC(CC2)NC(C3=C(C=CC=C3)C4=CC=C(C=C4)C(F)(F)F)=O)C=5C=CC=CC5C6=C1C=CC=C6 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22702 http://purl.obolibrary.org/obo/CHEBI_83565 |