loading...| Preferred Name |
Metyrosine |
|
| Synonyms |
alpha-methyl-L-tyrosine Methyltyrosine metirosinum L-alpha-Methyltyrosine alpha-methyl-para-tyrosine alpha-methyl-p-tyrosine (-)-alpha-Methyl-L-tyrosine alpha-methyl-L-p-tyrosine (S)-alpha-Methyltyrosine alpha-Methyltyrosine Metyrosine metirosina metirosine |
|
| Definitions |
An L-tyrosine derivative that consists of L-tyrosine bearing an additional methyl substituent at position 2. An inhibitor of the enzyme tyrosine 3-monooxygenase, and consequently of the synthesis of catecholamines. It is used to control the symptoms of excessive sympathetic stimulation in patients with pheochromocytoma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6912 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00762 CAS:672-87-7 Patent:US2011104765 KEGG:C07921 Wikipedia:Metirosine Drug_Central:1792 PMID:29668781 DrugBank:DB00765 Reaxys:2368400 PMID:29438107 PMID:29353821 PMID:28716505 |
|
| definition |
An L-tyrosine derivative that consists of L-tyrosine bearing an additional methyl substituent at position 2. An inhibitor of the enzyme tyrosine 3-monooxygenase, and consequently of the synthesis of catecholamines. It is used to control the symptoms of excessive sympathetic stimulation in patients with pheochromocytoma. |
|
| formula |
C10H13NO3 |
|
| has role | ||
| has_exact_synonym |
alpha-methyl-L-tyrosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Methyltyrosine metirosinum L-alpha-Methyltyrosine alpha-methyl-para-tyrosine alpha-methyl-p-tyrosine (-)-alpha-Methyl-L-tyrosine alpha-methyl-L-p-tyrosine (S)-alpha-Methyltyrosine alpha-Methyltyrosine Metyrosine metirosina metirosine |
|
| has_RxCUI |
266604 |
|
| id |
CHEBI:6912 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14)/t10-/m0/s1 |
|
| inchikey |
NHTGHBARYWONDQ-JTQLQIEISA-N |
|
| label |
alpha-methyl-L-tyrosine Metyrosine |
|
| mass |
195.21510 |
|
| monoisotopicmass |
195.08954 |
|
| notation |
CHEBI:6912 |
|
| prefLabel |
Metyrosine |
|
| smiles |
C[C@](N)(Cc1ccc(O)cc1)C(O)=O |
|
| subClassOf |