loading...| Preferred Name |
conivaptan |
|
| Synonyms |
N-{4-[(2-methyl-4,5-dihydroimidazo[4,5-d][1]benzazepin-6(1H)-yl)carbonyl]phenyl}biphenyl-2-carboxamide Conivaptan 4'-((4,5-dihydro-2-methylimidazo(4,5-d)(1)benzazepin-6(1H)-yl)carbonyl)-2-biphenylcarboxanilide conivaptan |
|
| Definitions |
The amide resulting from the formal condensation of 4-[(biphenyl-2-ylcarbonyl)amino]benzoic acid with the benzazepine nitrogen of 2-methyl-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine. It is an antagonist for two of the three types of arginine vasopressin (AVP) receptors, V1a and V2. It is used as its hydrochloride salt for the treatment of hyponatraemia (low blood sodium levels) caused by syndrome of inappropriate antidiuretic hormone (SIADH). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_681850 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D07748 Drug_Central:732 CAS:210101-16-9 Beilstein:8658375 PMID:20070106 DrugBank:DB00872 Wikipedia:Conivaptan |
|
| definition |
The amide resulting from the formal condensation of 4-[(biphenyl-2-ylcarbonyl)amino]benzoic acid with the benzazepine nitrogen of 2-methyl-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine. It is an antagonist for two of the three types of arginine vasopressin (AVP) receptors, V1a and V2. It is used as its hydrochloride salt for the treatment of hyponatraemia (low blood sodium levels) caused by syndrome of inappropriate antidiuretic hormone (SIADH). |
|
| formula |
C32H26N4O2 |
|
| has role | ||
| has_exact_synonym |
N-{4-[(2-methyl-4,5-dihydroimidazo[4,5-d][1]benzazepin-6(1H)-yl)carbonyl]phenyl}biphenyl-2-carboxamide Conivaptan |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4'-((4,5-dihydro-2-methylimidazo(4,5-d)(1)benzazepin-6(1H)-yl)carbonyl)-2-biphenylcarboxanilide conivaptan |
|
| has_RxCUI |
302285 |
|
| id |
CHEBI:681850 |
|
| in_subset | ||
| inchi |
InChI=1S/C32H26N4O2/c1-21-33-28-19-20-36(29-14-8-7-13-27(29)30(28)34-21)32(38)23-15-17-24(18-16-23)35-31(37)26-12-6-5-11-25(26)22-9-3-2-4-10-22/h2-18H,19-20H2,1H3,(H,33,34)(H,35,37) |
|
| inchikey |
IKENVDNFQMCRTR-UHFFFAOYSA-N |
|
| label |
conivaptan |
|
| mass |
498.57440 |
|
| monoisotopicmass |
498.20558 |
|
| notation |
CHEBI:681850 |
|
| prefLabel |
conivaptan |
|
| smiles |
Cc1nc2CCN(C(=O)c3ccc(NC(=O)c4ccccc4-c4ccccc4)cc3)c3ccccc3-c2[nH]1 |
|
| subClassOf |