Preferred Name |
mepyramine |
|
Synonyms |
N-(4-methoxybenzyl)-N',N'-dimethyl-N-pyridin-2-ylethane-1,2-diamine Mepyramine N',N'-dimethyl-N-(p-methoxybenzyl)-N-(2-pyridyl)ethylenediamine N-(p-methoxybenzyl)-N',N'-dimethyl-N-(alpha-pyridyl)ethylenediamine N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-1,2-ethanediamine pyranisamine Pyrilamine |
|
Definitions |
An ethylenediamine derivative that is ethylenediamine in which one of the amino nitrogens is substituted by two methyl groups and the remaining amino nitrogen is substituted by a 4-methoxybenzyl and a pyridin-2-yl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6762 |
|
charge |
0 |
|
database_cross_reference |
CAS:91-84-9 Beilstein:269019 Wikipedia:Pyrilamine Gmelin:877512 PMID:24813183 KEGG:C11798 Reaxys:269019 PMID:24316866 DrugBank:DB06691 HMDB:HMDB0015639 Drug_Central:2331 LINCS:LSM-4206 KEGG:D08183 |
|
definition |
An ethylenediamine derivative that is ethylenediamine in which one of the amino nitrogens is substituted by two methyl groups and the remaining amino nitrogen is substituted by a 4-methoxybenzyl and a pyridin-2-yl group. |
|
formula |
C17H23N3O |
|
has role | ||
has_exact_synonym |
N-(4-methoxybenzyl)-N',N'-dimethyl-N-pyridin-2-ylethane-1,2-diamine Mepyramine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N',N'-dimethyl-N-(p-methoxybenzyl)-N-(2-pyridyl)ethylenediamine N-(p-methoxybenzyl)-N',N'-dimethyl-N-(alpha-pyridyl)ethylenediamine N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-1,2-ethanediamine pyranisamine Pyrilamine |
|
has_RxCUI |
9009 |
|
id |
CHEBI:6762 |
|
in_subset | ||
inchi |
InChI=1S/C17H23N3O/c1-19(2)12-13-20(17-6-4-5-11-18-17)14-15-7-9-16(21-3)10-8-15/h4-11H,12-14H2,1-3H3 |
|
inchikey |
YECBIJXISLIIDS-UHFFFAOYSA-N |
|
label |
Pyrilamine mepyramine |
|
mass |
285.38414 |
|
monoisotopicmass |
285.18411 |
|
notation |
CHEBI:6762 |
|
prefLabel |
mepyramine |
|
smiles |
COc1ccc(CN(CCN(C)C)c2ccccn2)cc1 |
|
subClassOf |