loading...| Preferred Name |
menadiol |
|
| Synonyms |
2-Methylnaphthalene-1,4-diol Reduced vitamin K3 Vitamin K3H2 2-Methylhydronaphthoquinone Methylnaphthohydroquinone Dihydrovitamin K3 2-Methyl-1,4-naphthoquinol 2-Methyl-1,4-naphthohydroquinone Reduced menadione 2-methylnaphthalene-1,4-diol menadiol |
|
| Definitions |
A naphthalene-1,4-diol having a methyl substituent at the 2-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6746 |
|
| alternative label |
2-Methylnaphthalene-1,4-diol Reduced vitamin K3 Vitamin K3H2 2-Methylhydronaphthoquinone Methylnaphthohydroquinone Dihydrovitamin K3 2-Methyl-1,4-naphthoquinol 2-Methyl-1,4-naphthohydroquinone Reduced menadione 2-methylnaphthalene-1,4-diol menadiol |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1638194 KEGG:D08175 CAS:481-85-6 KEGG:C07126 |
|
| definition |
A naphthalene-1,4-diol having a methyl substituent at the 2-position. |
|
| formula |
C11H10O2 |
|
| has functional parent | ||
| has_exact_synonym |
2-methylnaphthalene-1,4-diol menadiol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Methylnaphthalene-1,4-diol Reduced vitamin K3 Vitamin K3H2 2-Methylhydronaphthoquinone Methylnaphthohydroquinone Dihydrovitamin K3 2-Methyl-1,4-naphthoquinol 2-Methyl-1,4-naphthohydroquinone Reduced menadione |
|
| has_RxCUI |
29491 |
|
| id |
CHEBI:6746 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H10O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6,12-13H,1H3 |
|
| inchikey |
ZJTLZYDQJHKRMQ-UHFFFAOYSA-N |
|
| label |
menadiol |
|
| mass |
174.19590 |
|
| monoisotopicmass |
174.06808 |
|
| notation |
CHEBI:6746 |
|
| prefLabel |
menadiol |
|
| smiles |
Cc1cc(O)c2ccccc2c1O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23783 |