Preferred Name |
Mefenamate |
|
Synonyms |
2-[(2,3-dimethylphenyl)amino]benzoic acid acido mefenamico acide mefenamique N-(2,3-xylyl)-2-aminobenzoic acid N-2,3-xylylanthranilic acid acidum mefenamicum mefenamic acid Mefenaminsaeure CI-473 CN 35355 CN-35355 INF 3355 INF-3355 Ponstel |
|
Definitions |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6717 |
|
charge |
0 |
|
database_cross_reference |
PMID:23656341 Patent:US3138636 Patent:BE605302 PMID:5286553 PMID:6155061 PMID:22275128 Wikipedia:Mefenamic_acid KEGG:D00151 KEGG:C02168 HMDB:HMDB0014922 Reaxys:2216243 PMID:4212650 PMID:425903 PDBeChem:ID8 PMID:2684858 PMID:4916242 LINCS:LSM-4085 PMID:23402341 PMID:22369458 PMID:14001132 PMID:17330662 CAS:61-68-7 PMID:28166217 PMID:577447 DrugBank:DB00784 Drug_Central:1663 PMID:23494912 PMID:3304401 |
|
definition |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis. |
|
formula |
C15H15NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35480 |
|
has_exact_synonym |
2-[(2,3-dimethylphenyl)amino]benzoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acido mefenamico acide mefenamique N-(2,3-xylyl)-2-aminobenzoic acid N-2,3-xylylanthranilic acid acidum mefenamicum mefenamic acid Mefenaminsaeure CI-473 CN 35355 CN-35355 INF 3355 INF-3355 Ponstel |
|
has_RxCUI |
257844 |
|
id |
CHEBI:6717 |
|
in_subset | ||
inchi |
InChI=1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
|
inchikey |
HYYBABOKPJLUIN-UHFFFAOYSA-N |
|
label |
mefenamic acid Mefenamate |
|
mass |
241.28510 |
|
monoisotopicmass |
241.11028 |
|
notation |
CHEBI:6717 |
|
prefLabel |
Mefenamate |
|
smiles |
Cc1cccc(Nc2ccccc2C(O)=O)c1C |
|
subClassOf |