loading...| Preferred Name | meclofenamic acid | |
| Synonyms |
N-(2,6-dichloro-3-methylphenyl)anthranilic acid acido meclofenamico acidum meclofenamicum N-(3-methyl-2,6-dichlorophenyl)anthranilic acid N-(2,6-dichloro-m-tolyl)anthranilic acid meclofenamic acid acide meclofenamique CI-583 INF 4668 2-[(2,6-dichloro-3-methylphenyl)amino]benzoic acid |
|
| Definitions |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,6-dichloro-3-methylphenyl group. A non-steroidal anti-inflammatory drug, it is used as the sodium salt for the treatment of dysmenorrhoea (painful periods), osteoarthritis and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6710 |
|
| alternative label |
N-(2,6-dichloro-3-methylphenyl)anthranilic acid acido meclofenamico acidum meclofenamicum N-(3-methyl-2,6-dichlorophenyl)anthranilic acid N-(2,6-dichloro-m-tolyl)anthranilic acid meclofenamic acid acide meclofenamique CI-583 INF 4668 2-[(2,6-dichloro-3-methylphenyl)amino]benzoic acid |
|
| charge |
0 |
|
| database_cross_reference |
PMID:7349327 HMDB:HMDB0015074 PMID:19279153 Drug_Central:1650 PMID:1810521 KEGG:C07117 PMID:23567745 Patent:US3313848 PMID:23534549 DrugBank:DB00939 PMID:21660425 PMID:16986603 PMID:23584353 Wikipedia:Meclofenamic_acid PDBeChem:JMS LINCS:LSM-3108 Patent:DE1149045 PMID:17348907 KEGG:D02341 Reaxys:2221428 PMID:15598972 PMID:322627 CAS:644-62-2 |
|
| definition |
An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,6-dichloro-3-methylphenyl group. A non-steroidal anti-inflammatory drug, it is used as the sodium salt for the treatment of dysmenorrhoea (painful periods), osteoarthritis and rheumatoid arthritis. |
|
| formula |
C14H11Cl2NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_64964 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35480 |
|
| has_exact_synonym |
2-[(2,6-dichloro-3-methylphenyl)amino]benzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-(2,6-dichloro-3-methylphenyl)anthranilic acid acido meclofenamico acidum meclofenamicum N-(3-methyl-2,6-dichlorophenyl)anthranilic acid N-(2,6-dichloro-m-tolyl)anthranilic acid meclofenamic acid acide meclofenamique CI-583 INF 4668 |
|
| id |
CHEBI:6710 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19) |
|
| inchikey |
SBDNJUWAMKYJOX-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
meclofenamic acid |
|
| mass |
296.14900 |
|
| monoisotopicmass |
295.01668 |
|
| notation |
CHEBI:6710 |
|
| prefLabel |
meclofenamic acid |
|
| smiles |
Cc1ccc(Cl)c(Nc2ccccc2C(O)=O)c1Cl |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22495 |