loading...| Preferred Name | levobunolol | |
| Synonyms |
(-)-Bunolol levobunololum (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone Levobunolol 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one |
|
| Definitions |
A cyclic ketone that is 3,4-dihydronaphthalen-1-one substituted at position 5 by a 3-(tert-butylamino)-2-hydroxypropoxy group (the S-enantiomer). A non-selective beta-adrenergic antagonist used (as its hydrochloride salt) for treatment of glaucoma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6438 |
|
| alternative label |
(-)-Bunolol levobunololum (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone Levobunolol 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one |
|
| charge |
0 |
|
| database_cross_reference |
PMID:3062528 PMID:23390358 PMID:3058836 PMID:3912600 PMID:17459374 Patent:US2011275617 PMID:20960417 PMID:29277497 PMID:19626454 PMID:3067745 KEGG:D08115 PMID:2881799 Beilstein:6484587 PMID:2873545 LINCS:LSM-6578 Drug_Central:431 PMID:3050679 PMID:3881032 PMID:26227808 PMID:37861808 DrugBank:DB01210 PMID:27190057 PMID:3019819 PMID:21368570 PMID:30000211 Patent:US2011263638 Wikipedia:Levobunolol Patent:WO2011140194 KEGG:C07914 PMID:34863129 Patent:WO2008002929 CAS:47141-42-4 HMDB:HMDB0015341 PMID:3513594 Reaxys:6484587 |
|
| definition |
A cyclic ketone that is 3,4-dihydronaphthalen-1-one substituted at position 5 by a 3-(tert-butylamino)-2-hydroxypropoxy group (the S-enantiomer). A non-selective beta-adrenergic antagonist used (as its hydrochloride salt) for treatment of glaucoma. |
|
| formula |
C17H25NO3 |
|
| has parent hydride | ||
| has role | ||
| has_exact_synonym |
Levobunolol 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(-)-Bunolol levobunololum (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone |
|
| has_RxCUI |
1813 |
|
| id |
CHEBI:6438 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
|
| inchikey |
IXHBTMCLRNMKHZ-LBPRGKRZSA-N |
|
| is conjugate acid of | ||
| label |
levobunolol |
|
| mass |
291.38534 |
|
| monoisotopicmass |
291.18344 |
|
| notation |
CHEBI:6438 |
|
| prefLabel |
levobunolol |
|
| smiles |
CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35533 |