Preferred Name | succimer | |
Synonyms |
(R*,S*)-2,3-Dimercaptobutanedioic acid meso-2,3-Dimercaptosuccinic acid meso-Dimercaptosuccinic acid meso-2,3-Dimercaptobernsteinsaeure Dimercaptosuccinic acid DMSA succimer succimero succimerum (2R,3S)-2,3-disulfanylsuccinic acid |
|
Definitions |
A sulfur-containing carboxylic acid that is succinic acid bearing two mercapto substituents at positions 2 and 3. A lead chelator used as an antedote to lead poisoning. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63623 |
|
alternative label |
(R*,S*)-2,3-Dimercaptobutanedioic acid meso-2,3-Dimercaptosuccinic acid meso-Dimercaptosuccinic acid meso-2,3-Dimercaptobernsteinsaeure Dimercaptosuccinic acid DMSA succimer succimero succimerum (2R,3S)-2,3-disulfanylsuccinic acid |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1725150 KEGG:C07598 PMID:21112928 PMID:19123743 KEGG:D00572 CAS:304-55-2 Reaxys:1725150 PMID:22234625 Wikipedia:Succimer DrugBank:DB00566 LINCS:LSM-4749 Drug_Central:2486 |
|
definition |
A sulfur-containing carboxylic acid that is succinic acid bearing two mercapto substituents at positions 2 and 3. A lead chelator used as an antedote to lead poisoning. |
|
formula |
C4H6O4S2 |
|
has role | ||
has_alternative_id |
CHEBI:9303 |
|
has_exact_synonym |
(2R,3S)-2,3-disulfanylsuccinic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(R*,S*)-2,3-Dimercaptobutanedioic acid meso-2,3-Dimercaptosuccinic acid meso-Dimercaptosuccinic acid meso-2,3-Dimercaptobernsteinsaeure Dimercaptosuccinic acid DMSA succimer succimero succimerum |
|
has_RxCUI |
3446 |
|
id |
CHEBI:63623 |
|
in_subset | ||
inchi |
InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2+ |
|
inchikey |
ACTRVOBWPAIOHC-XIXRPRMCSA-N |
|
label |
succimer |
|
mass |
182.21800 |
|
monoisotopicmass |
181.97075 |
|
notation |
CHEBI:63623 |
|
prefLabel |
succimer |
|
smiles |
OC(=O)[C@@H](S)[C@@H](S)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33576 |