loading...| Preferred Name |
guanadrel |
|
| Synonyms |
guanadrelum guanadrel 1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel |
|
| Definitions |
A spiroketal resulting from the formal condensation of the keto group of cyclohexanone with the hydroxy groups of 1-(2,3-dihydroxypropyl)guanidine. A postganglionic adrenergic blocking agent formerly used (generally as the sulfate salt) for the management of hypertension, it has been largely superseded by other drugs less likely to cause orthostatic hypotension (dizzy spells on standing up or stretching). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5555 |
|
| alternative label |
guanadrelum guanadrel 1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel |
|
| charge |
0 |
|
| database_cross_reference |
PMID:7206175 Drug_Central:1339 Beilstein:8325419 PMID:6621504 KEGG:C07035 Wikipedia:Guanadrel DrugBank:DB00226 PMID:3896742 HMDB:HMDB0014371 Patent:US3547951 Reaxys:8325419 CAS:40580-59-4 KEGG:D08029 |
|
| definition |
A spiroketal resulting from the formal condensation of the keto group of cyclohexanone with the hydroxy groups of 1-(2,3-dihydroxypropyl)guanidine. A postganglionic adrenergic blocking agent formerly used (generally as the sulfate salt) for the management of hypertension, it has been largely superseded by other drugs less likely to cause orthostatic hypotension (dizzy spells on standing up or stretching). |
|
| formula |
C10H19N3O2 |
|
| has role | ||
| has_exact_synonym |
1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
guanadrelum guanadrel |
|
| has_RxCUI |
26296 |
|
| id |
CHEBI:5555 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
|
| inchikey |
HPBNRIOWIXYZFK-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
guanadrel |
|
| mass |
213.27680 |
|
| monoisotopicmass |
213.14773 |
|
| notation |
CHEBI:5555 |
|
| prefLabel |
guanadrel |
|
| smiles |
NC(=N)NCC1COC2(CCCCC2)O1 |
|
| subClassOf |