Preferred Name |
Triolein |
|
Synonyms |
propane-1,2,3-triyl tris[(9Z)-octadec-9-enoate] Glycerol triolein (Z)-9-Octadecenoic acid, 1,2,3-propanetriyl ester Glyceryl trioleate Oleyl triglyceride Oleic triglyceride Oleic acid triglyceride Glyceryl-1,2,3-trioleate Glycerol, tri(cis-9-octadecenoate) Glycerin trioleate propane-1,2,3-triyl (9Z,9'Z,9''Z)tris-octadec-9-enoate TG(18:1(9Z)/18:1(9Z)/18:1(9Z))[iso] Trioleoylglycerol Trioleoylglyceride Glycerol trioleate 1,2,3-tri-(9Z-octadecenoyl)-glycerol Olein |
|
Definitions |
A triglyceride formed by esterification of the three hydroxy groups of glycerol with oleic acid. Triolein is one of the two components of Lorenzo's oil. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53753 |
|
charge |
0 |
|
database_cross_reference |
PMID:23475189 PMID:25045169 PMID:24604600 PMID:24288099 PMID:11304127 LIPID_MAPS_instance:LMGL03010250 PMID:24810291 Beilstein:1718692 Reaxys:1718692 Wikipedia:Triolein CAS:122-32-7 PMID:24489110 HMDB:HMDB0005453 MetaCyc:CPD-11691 PMID:24859695 PMID:24362891 PPDB:491 |
|
definition |
A triglyceride formed by esterification of the three hydroxy groups of glycerol with oleic acid. Triolein is one of the two components of Lorenzo's oil. |
|
formula |
C57H104O6 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
propane-1,2,3-triyl tris[(9Z)-octadec-9-enoate] |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Glycerol triolein (Z)-9-Octadecenoic acid, 1,2,3-propanetriyl ester Glyceryl trioleate Oleyl triglyceride Oleic triglyceride Oleic acid triglyceride Glyceryl-1,2,3-trioleate Glycerol, tri(cis-9-octadecenoate) Glycerin trioleate propane-1,2,3-triyl (9Z,9'Z,9''Z)tris-octadec-9-enoate TG(18:1(9Z)/18:1(9Z)/18:1(9Z))[iso] Trioleoylglycerol Trioleoylglyceride Glycerol trioleate 1,2,3-tri-(9Z-octadecenoyl)-glycerol Olein |
|
has_RxCUI |
1368168 |
|
id |
CHEBI:53753 |
|
in_subset | ||
inchi |
InChI=1S/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
|
inchikey |
PHYFQTYBJUILEZ-IUPFWZBJSA-N |
|
label |
Triolein triolein |
|
mass |
885.43210 |
|
monoisotopicmass |
884.78329 |
|
notation |
CHEBI:53753 |
|
prefLabel |
Triolein |
|
smiles |
CCCCCCCC\C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCC\C=C/CCCCCCCC |
|
subClassOf |