Preferred Name |
alverine |
|
Synonyms |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine N-Ethyl-N-(3-phenylpropyl)benzenepropanamine N-Ethyl-3,3'-diphenyldipropylamine Phenpropamine Bis(gamma-phenylpropyl)ethylamine Di(phenylpropyl)ethylamine Phenopropamine N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine N,N-Bis(3-phenylpropyl)ethylamine alverina alverine alverinum |
|
Definitions |
A tertiary amine having one ethyl and two 3-phenylprop-1-yl groups attached to the nitrogen. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used (particularly as the citrate salt) in the treatment of irritable bowel syndrome. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_518413 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:2856783 CAS:150-59-4 DrugBank:DB01616 KEGG:D07440 Drug_Central:142 LINCS:LSM-3988 |
|
definition |
A tertiary amine having one ethyl and two 3-phenylprop-1-yl groups attached to the nitrogen. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used (particularly as the citrate salt) in the treatment of irritable bowel syndrome. |
|
formula |
C20H27N |
|
has role | ||
has_exact_synonym |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-Ethyl-N-(3-phenylpropyl)benzenepropanamine N-Ethyl-3,3'-diphenyldipropylamine Phenpropamine Bis(gamma-phenylpropyl)ethylamine Di(phenylpropyl)ethylamine Phenopropamine N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine N,N-Bis(3-phenylpropyl)ethylamine alverina alverine alverinum |
|
has_RxCUI |
17627 |
|
id |
CHEBI:518413 |
|
in_subset | ||
inchi |
InChI=1S/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 |
|
inchikey |
ZPFXAOWNKLFJDN-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
alverine |
|
mass |
281.43510 |
|
monoisotopicmass |
281.21435 |
|
notation |
CHEBI:518413 |
|
prefLabel |
alverine |
|
smiles |
CCN(CCCc1ccccc1)CCCc1ccccc1 |
|
subClassOf |