Preferred Name |
flurbiprofen |
|
Synonyms |
2-fluoro-alpha-methyl-(1,1'-biphenyl)-4-acetic acid 2-(2-fluorobiphenyl-4-yl)propanoic acid 3-fluoro-4-phenylhydratropic acid (+-)-2-fluoro-alpha-methyl-4-biphenylacetic acid Ansaid 2-(2-fluoro-[1,1'-biphenyl-4-yl])propanoic acid Flurbiprofen |
|
Definitions |
A monocarboxylic acid that is a 2-fluoro-[1,1'-biphenyl-4-yl] moiety linked to C-2 of propionic acid. A non-steroidal anti-inflammatory, analgesic and antipyretic, it is used as a pre-operative anti-miotic as well as orally for arthritis or dental pain. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5130 |
|
alternative label |
2-fluoro-alpha-methyl-(1,1'-biphenyl)-4-acetic acid 2-(2-fluorobiphenyl-4-yl)propanoic acid 3-fluoro-4-phenylhydratropic acid (+-)-2-fluoro-alpha-methyl-4-biphenylacetic acid Ansaid 2-(2-fluoro-[1,1'-biphenyl-4-yl])propanoic acid Flurbiprofen |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5174 PMID:28298171 PMID:27832658 Wikipedia:Flurbiprofen PMID:28402193 DrugBank:DB00712 Beilstein:2054451 PMID:12859660 Drug_Central:1219 PMID:28147361 PMID:17562170 PMID:28166217 PMID:27746736 PMID:19588427 CAS:5104-49-4 KEGG:D00330 |
|
definition |
A monocarboxylic acid that is a 2-fluoro-[1,1'-biphenyl-4-yl] moiety linked to C-2 of propionic acid. A non-steroidal anti-inflammatory, analgesic and antipyretic, it is used as a pre-operative anti-miotic as well as orally for arthritis or dental pain. |
|
formula |
C15H13FO2 |
|
has functional parent | ||
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35544 |
|
has_exact_synonym |
2-(2-fluoro-[1,1'-biphenyl-4-yl])propanoic acid Flurbiprofen |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-fluoro-alpha-methyl-(1,1'-biphenyl)-4-acetic acid 2-(2-fluorobiphenyl-4-yl)propanoic acid 3-fluoro-4-phenylhydratropic acid (+-)-2-fluoro-alpha-methyl-4-biphenylacetic acid Ansaid |
|
has_RxCUI |
4502 |
|
id |
CHEBI:5130 |
|
in_subset | ||
inchi |
InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18) |
|
inchikey |
SYTBZMRGLBWNTM-UHFFFAOYSA-N |
|
label |
Flurbiprofen flurbiprofen |
|
mass |
244.26092 |
|
monoisotopicmass |
244.08996 |
|
notation |
CHEBI:5130 |
|
prefLabel |
flurbiprofen |
|
smiles |
CC(C(O)=O)c1ccc(c(F)c1)-c1ccccc1 |
|
subClassOf |