loading...| Preferred Name | epinastine | |
| Synonyms |
3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine (+-)-epinastine epinastinum epinastina epinastine 9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
|
| Definitions |
A benzazepine that is 6,11-dihydro-5H-dibenzo[b,e]azepine in which the azepine ring is fused to the e side of 4,5-dihydro-1H-imidazol-2-amine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51032 |
|
| alternative label |
3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine (+-)-epinastine epinastinum epinastina epinastine 9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Epinastine Patent:GB2071095 Beilstein:3593307 Patent:US4313931 CAS:80012-43-7 KEGG:D07900 Drug_Central:1027 DrugBank:DB00751 Reaxys:3593307 |
|
| definition |
A benzazepine that is 6,11-dihydro-5H-dibenzo[b,e]azepine in which the azepine ring is fused to the e side of 4,5-dihydro-1H-imidazol-2-amine. |
|
| formula |
C16H15N3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 |
|
| has_exact_synonym |
9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine (+-)-epinastine epinastinum epinastina epinastine |
|
| has_RxCUI |
39684 |
|
| id |
CHEBI:51032 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H15N3/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16/h1-8,15H,9-10H2,(H2,17,18) |
|
| inchikey |
WHWZLSFABNNENI-UHFFFAOYSA-N |
|
| label |
epinastine |
|
| mass |
249.31040 |
|
| monoisotopicmass |
249.12660 |
|
| notation |
CHEBI:51032 |
|
| prefLabel |
epinastine |
|
| smiles |
NC1=NCC2N1c1ccccc1Cc1ccccc21 |
|
| subClassOf |