loading...| Preferred Name | finasteride | |
| Synonyms |
finasterida finasteride finasteridum (5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide N-tert-butyl-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| Definitions |
An aza-steroid that is a synthetic drug for the treatment of benign prostatic hyperplasia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5062 |
|
| alternative label |
finasterida finasteride finasteridum (5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide N-tert-butyl-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US4760071 CAS:98319-26-7 KEGG:D00321 Drug_Central:1171 Wikipedia:Finasteride DrugBank:DB01216 LINCS:LSM-1999 PMID:23552442 Patent:EP155096 Reaxys:4269024 Beilstein:4269024 HMDB:HMDB0001984 PMID:15956333 |
|
| definition |
An aza-steroid that is a synthetic drug for the treatment of benign prostatic hyperplasia. |
|
| formula |
C23H36N2O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35497 |
|
| has_exact_synonym |
N-tert-butyl-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
finasterida finasteride finasteridum (5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide |
|
| has_RxCUI |
25025 |
|
| id |
CHEBI:5062 |
|
| in_subset | ||
| inchi |
InChI=1S/C23H36N2O2/c1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/h11,13-18H,6-10,12H2,1-5H3,(H,24,26)(H,25,27)/t14-,15-,16-,17+,18+,22-,23+/m0/s1 |
|
| inchikey |
DBEPLOCGEIEOCV-WSBQPABSSA-N |
|
| label |
finasteride |
|
| mass |
372.545 |
|
| monoisotopicmass |
372.27768 |
|
| notation |
CHEBI:5062 |
|
| prefLabel |
finasteride |
|
| smiles |
C1=CC(N[C@]2([C@]1([C@@]3([C@@](CC2)([C@]4([C@](CC3)([C@](CC4)(C(NC(C)(C)C)=O)[H])C)[H])[H])[H])C)[H])=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35726 |