loading...| Preferred Name | famciclovir | |
| Synonyms |
2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester famciclovirum famciclovir 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine BRL-42810 FCV Famvir 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate FAMCICLOVIR |
|
| Definitions |
2-Amino-9H-purine in which the hydrogen at position 9 is substituted by a 4-acetoxy-3-(acetoxymethyl)but-1-yl group. A prodrug of the antiviral penciclovir, it is used for the treatment of acute herpes zoster (shingles), for the treatment or suppression of recurrent genital herpes in immunocompetent patients and for the treatment of recurrent mucocutaneous herpes simplex infections in HIV infected patients. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4974 |
|
| alternative label |
2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester famciclovirum famciclovir 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine BRL-42810 FCV Famvir 2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate FAMCICLOVIR |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:4208403 Wikipedia:Famciclovir PMID:9719596 HMDB:HMDB0014570 PMID:2754699 Patent:US5246937 DrugBank:DB00426 CAS:104227-87-4 PMID:17870541 LINCS:LSM-2990 KEGG:D00317 Drug_Central:1128 |
|
| definition |
2-Amino-9H-purine in which the hydrogen at position 9 is substituted by a 4-acetoxy-3-(acetoxymethyl)but-1-yl group. A prodrug of the antiviral penciclovir, it is used for the treatment of acute herpes zoster (shingles), for the treatment or suppression of recurrent genital herpes in immunocompetent patients and for the treatment of recurrent mucocutaneous herpes simplex infections in HIV infected patients. |
|
| formula |
C14H19N5O4 |
|
| has role | ||
| has_alternative_id |
CHEBI:174284 |
|
| has_exact_synonym |
2-[(acetyloxy)methyl]-4-(2-amino-9H-purin-9-yl)butyl acetate FAMCICLOVIR |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(2-(2-amino-9H-purin-9-yl)ethyl)-1,3-propanediol diacetate acetic acid 2-acetoxymethyl-4-(2-amino-purin-9-yl)-butyl ester famciclovirum famciclovir 9-[4-acetoxy-3-(acetoxymethyl)but-1-yl]-2-aminopurine BRL-42810 FCV Famvir |
|
| has_RxCUI |
68099 |
|
| id |
CHEBI:4974 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
|
| inchikey |
GGXKWVWZWMLJEH-UHFFFAOYSA-N |
|
| label |
famciclovir |
|
| mass |
321.33180 |
|
| monoisotopicmass |
321.14370 |
|
| notation |
CHEBI:4974 |
|
| prefLabel |
famciclovir |
|
| smiles |
CC(=O)OCC(CCn1cnc2cnc(N)nc12)COC(C)=O |
|
| subClassOf |