Preferred Name | encainide | |
Synonyms |
4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide (+-)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide (+-)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide encainida encainide encainidum 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide Encainide |
|
Definitions |
4-Methoxy-N-phenylbenzamide in which the hydrogen at the 2 position of the phenyl group is substituted by a 2-(1-methylpiperidin-2-yl)ethyl group. A class Ic antiarrhythmic, the hydrochloride was used for the treatment of severe or life-threatening ventricular arrhythmias, but it was associated with increased death rates in patients who had asymptomatic heart rhythm abnormalities after a recent heart attack and was withdrawn from the market. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4788 |
|
alternative label |
4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide (+-)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide (+-)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide encainida encainide encainidum 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide Encainide |
|
charge |
0 |
|
database_cross_reference |
Patent:US3931195 KEGG:D07894 Drug_Central:1007 Patent:DE2210154 CAS:66778-36-7 Beilstein:497572 DrugBank:DB01228 KEGG:C06978 |
|
definition |
4-Methoxy-N-phenylbenzamide in which the hydrogen at the 2 position of the phenyl group is substituted by a 2-(1-methylpiperidin-2-yl)ethyl group. A class Ic antiarrhythmic, the hydrochloride was used for the treatment of severe or life-threatening ventricular arrhythmias, but it was associated with increased death rates in patients who had asymptomatic heart rhythm abnormalities after a recent heart attack and was withdrawn from the market. |
|
formula |
C22H28N2O2 |
|
has role | ||
has_alternative_id |
CHEBI:239046 |
|
has_exact_synonym |
4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide Encainide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide (+-)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide (+-)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide encainida encainide encainidum |
|
has_RxCUI |
42368 |
|
id |
CHEBI:4788 |
|
in_subset | ||
inchi |
InChI=1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
|
inchikey |
PJWPNDMDCLXCOM-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
encainide |
|
mass |
352.46990 |
|
monoisotopicmass |
352.21508 |
|
notation |
CHEBI:4788 |
|
prefLabel |
encainide |
|
smiles |
COc1ccc(cc1)C(=O)Nc1ccccc1CCC1CCCCN1C |
|
subClassOf |