loading...| Preferred Name |
zoledronic acid |
|
| Synonyms |
[1-hydroxy-2-(1H-imidazol-1-yl)ethane-1,1-diyl]bis(phosphonic acid) ZOLEDRONIC ACID zoledronic acid (1-hydroxy-2-(1H-imidazol-1-yl)ethylidene)bisphosphonic acid (1-hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid Reclast ZOL |
|
| Definitions |
An imidazole compound having a 2,2-bis(phosphono)-2-hydroxyethane-1-yl substituent at the 1-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_46557 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:34585443 PMID:34447747 PMID:15161327 PMID:34560734 PMID:16414486 CAS:118072-93-8 PMID:34157824 PMID:33908127 KEGG:D08689 Drug_Central:2868 PMID:17691952 PMID:34393156 PMID:34341833 PMID:34413050 Gmelin:2609374 PMID:33984339 Chemspider:61986 Patent:US4939130 PMID:34475752 PMID:34081204 Beilstein:9205049 PMID:15324309 PDBeChem:ZOL PMID:12183663 Wikipedia:Zoledronic_acid PMID:18982915 PMCID:PMC8090009 DrugBank:DB00399 PMID:19751105 PMID:34324430 PMID:34435997 |
|
| definition |
An imidazole compound having a 2,2-bis(phosphono)-2-hydroxyethane-1-yl substituent at the 1-position. |
|
| formula |
C5H10N2O7P2 |
|
| has role | ||
| has_exact_synonym |
[1-hydroxy-2-(1H-imidazol-1-yl)ethane-1,1-diyl]bis(phosphonic acid) ZOLEDRONIC ACID |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
zoledronic acid (1-hydroxy-2-(1H-imidazol-1-yl)ethylidene)bisphosphonic acid (1-hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid Reclast ZOL |
|
| has_RxCUI |
77655 |
|
| id |
CHEBI:46557 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) |
|
| inchikey |
XRASPMIURGNCCH-UHFFFAOYSA-N |
|
| label |
zoledronic acid |
|
| mass |
272.08970 |
|
| monoisotopicmass |
271.99632 |
|
| notation |
CHEBI:46557 |
|
| prefLabel |
zoledronic acid |
|
| smiles |
OC(Cn1ccnc1)(P(O)(O)=O)P(O)(O)=O |
|
| subClassOf |