Preferred Name |
Dexfenfluramine |
|
Synonyms |
(S)-fenfluramine (2S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dextrofenfluramine (+)-fenfluramine (S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dexfenfluraminum dexfenfluramine dexfenfluramina d-N-ethyl-alpha-methyl-m-trifluoromethylphenethylamine |
|
Definitions |
The S-enantiomer of fenfluramine. It stimulates the release of serotonin and selectively inhibits its reuptake, but unlike fenfluramine it does not possess catecholamine agonist activity. It was formerly given by mouth as the hydrochloride in the treatment of obesity, but, like fenfluramine, was withdrawn wolrdwide following reports of valvular heart defects. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_439329 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D07805 PMID:16257207 Beilstein:4783710 Patent:US3198834 LINCS:LSM-5685 Drug_Central:832 DrugBank:DB01191 CAS:3239-44-9 |
|
definition |
The S-enantiomer of fenfluramine. It stimulates the release of serotonin and selectively inhibits its reuptake, but unlike fenfluramine it does not possess catecholamine agonist activity. It was formerly given by mouth as the hydrochloride in the treatment of obesity, but, like fenfluramine, was withdrawn wolrdwide following reports of valvular heart defects. |
|
formula |
C12H16F3N |
|
has_exact_synonym |
(S)-fenfluramine (2S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
dextrofenfluramine (+)-fenfluramine (S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dexfenfluraminum dexfenfluramine dexfenfluramina d-N-ethyl-alpha-methyl-m-trifluoromethylphenethylamine |
|
has_RxCUI |
3268 |
|
id |
CHEBI:439329 |
|
in_subset | ||
inchi |
InChI=1S/C12H16F3N/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3/t9-/m0/s1 |
|
inchikey |
DBGIVFWFUFKIQN-VIFPVBQESA-N |
|
is enantiomer of | ||
is_bearer_of | ||
label |
(S)-fenfluramine Dexfenfluramine |
|
mass |
231.25730 |
|
monoisotopicmass |
231.12348 |
|
notation |
CHEBI:439329 |
|
prefLabel |
Dexfenfluramine |
|
smiles |
CCN[C@@H](C)Cc1cccc(c1)C(F)(F)F |
|
subClassOf |