Preferred Name |
Dantrolene |
|
Synonyms |
1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantrolenum dantrolene dantroleno 1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione Dantrolene |
|
Definitions |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. A ryanodine receptor antagonist used for the relief of chronic severe spasticity and malignant hyperthermia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4317 |
|
alternative label |
1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantrolenum dantrolene dantroleno 1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione Dantrolene |
|
charge |
0 |
|
database_cross_reference |
PMID:31478931 LINCS:LSM-3823 PMID:18696266 DrugBank:DB01219 Patent:US3415821 PMID:8797628 PMID:31775359 PMID:29921212 PMID:32016838 Patent:NL6612588 PMID:11934664 PMID:31918212 PMID:31633504 PMID:32060500 PMID:30776519 PMID:31901380 KEGG:C06939 CAS:7261-97-4 PMID:31851793 PMID:30948257 KEGG:D02347 Beilstein:705189 PMID:31337666 PMID:31906750 |
|
definition |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. A ryanodine receptor antagonist used for the relief of chronic severe spasticity and malignant hyperthermia. |
|
formula |
C14H10N4O5 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 |
|
has_exact_synonym |
1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione Dantrolene |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantrolenum dantrolene dantroleno |
|
has_RxCUI |
3105 |
|
id |
CHEBI:4317 |
|
in_subset | ||
inchi |
InChI=1S/C14H10N4O5/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H,16,19,20) |
|
inchikey |
OZOMQRBLCMDCEG-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
Dantrolene dantrolene |
|
mass |
314.257 |
|
monoisotopicmass |
314.06512 |
|
notation |
CHEBI:4317 |
|
prefLabel |
Dantrolene |
|
smiles |
C1(NC(=O)CN1N=C(C=2OC(C=3C=CC([N+]([O-])=O)=CC3)=CC2)[H])=O |
|
subClassOf |