Preferred Name |
Cyclizine |
|
Synonyms |
N-methyl-N'-benzhydrylpiperazine (N-Benzhydryl)(N'-methyl)diethylenediamine 1-Benzhydryl-4-methylpiperazin (+-)-1-diphenylmethyl-4-methylpiperazine N-Benzhydryl-N'-methylpiperazine 1-(Diphenylmethyl)-4-methylpiperazine ciclizina cyclizine cyclizinum 1-(diphenylmethyl)-4-methylpiperazine Cyclizine |
|
Definitions |
An N-alkylpiperazine in which one nitrogen of the piperazine ring is substituted by a methyl group, while the other is substituted by a diphenylmethyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3994 |
|
alternative label |
N-methyl-N'-benzhydrylpiperazine (N-Benzhydryl)(N'-methyl)diethylenediamine 1-Benzhydryl-4-methylpiperazin (+-)-1-diphenylmethyl-4-methylpiperazine N-Benzhydryl-N'-methylpiperazine 1-(Diphenylmethyl)-4-methylpiperazine ciclizina cyclizine cyclizinum 1-(diphenylmethyl)-4-methylpiperazine Cyclizine |
|
charge |
0 |
|
database_cross_reference |
PMID:24324230 Beilstein:230441 HMDB:HMDB0015307 DrugBank:DB01176 Patent:US2630435 PMID:24215049 Drug_Central:749 LINCS:LSM-5857 KEGG:C06930 Wikipedia:Cyclizine PMID:22209223 KEGG:D03621 Reaxys:230441 CAS:82-92-8 |
|
definition |
An N-alkylpiperazine in which one nitrogen of the piperazine ring is substituted by a methyl group, while the other is substituted by a diphenylmethyl group. |
|
formula |
C18H22N2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48873 http://purl.obolibrary.org/obo/CHEBI_36333 |
|
has_alternative_id |
CHEBI:127546 |
|
has_exact_synonym |
1-(diphenylmethyl)-4-methylpiperazine Cyclizine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-methyl-N'-benzhydrylpiperazine (N-Benzhydryl)(N'-methyl)diethylenediamine 1-Benzhydryl-4-methylpiperazin (+-)-1-diphenylmethyl-4-methylpiperazine N-Benzhydryl-N'-methylpiperazine 1-(Diphenylmethyl)-4-methylpiperazine ciclizina cyclizine cyclizinum |
|
has_RxCUI |
2977 |
|
id |
CHEBI:3994 |
|
in_subset | ||
inchi |
InChI=1S/C18H22N2/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3 |
|
inchikey |
UVKZSORBKUEBAZ-UHFFFAOYSA-N |
|
label |
Cyclizine cyclizine |
|
mass |
266.38070 266.38076 |
|
monoisotopicmass |
266.17830 |
|
notation |
CHEBI:3994 |
|
prefLabel |
Cyclizine |
|
smiles |
CN1CCN(CC1)C(c1ccccc1)c1ccccc1 |
|
subClassOf |