loading...| Preferred Name | clofibric acid | |
| Synonyms |
2-(4-Chlorophenoxy)-2-methylpropionic acid Chlorophibrinic acid acidum clofibricum alpha-(p-chlorophenoxy)isobutyric acid 2-(p-Chlorophenoxy)-2-methylpropionic acid Clofibrate free acid Clofibrinsaeure acido clofibrico Chlorfibrinic acid 2-(p-Chlorophenoxy)isobutyric acid Chlorofibrinic acid acide clofibrique alpha-(4-chlorophenoxy)-alpha-methylpropionic acid Acide (p-chlorophenoxy)-2 methyl-2 propionique clofibric acid 4-CPIB CPIB PCIB PCPIB Clofibric acid 2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
| Definitions |
A monocarboxylic acid that is isobutyric acid substituted at position 2 by a p-chlorophenoxy group. It is a metabolite of the drug clofibrate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34648 |
|
| alternative label |
2-(4-Chlorophenoxy)-2-methylpropionic acid Chlorophibrinic acid acidum clofibricum alpha-(p-chlorophenoxy)isobutyric acid 2-(p-Chlorophenoxy)-2-methylpropionic acid Clofibrate free acid Clofibrinsaeure acido clofibrico Chlorfibrinic acid 2-(p-Chlorophenoxy)isobutyric acid Chlorofibrinic acid acide clofibrique alpha-(4-chlorophenoxy)-alpha-methylpropionic acid Acide (p-chlorophenoxy)-2 methyl-2 propionique clofibric acid 4-CPIB CPIB PCIB PCPIB Clofibric acid 2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-2427 PMID:23135717 KEGG:C13700 Beilstein:1874067 PMID:23062606 PMID:23352585 Pesticides:clofibric%20acid Drug_Central:695 Wikipedia:Clofibric_acid KEGG:D07723 PMID:8944746 PMID:17431116 PMID:16442995 CAS:882-09-7 Reaxys:1874067 PMID:7320112 PPDB:2940 |
|
| definition |
A monocarboxylic acid that is isobutyric acid substituted at position 2 by a p-chlorophenoxy group. It is a metabolite of the drug clofibrate. |
|
| formula |
C10H11ClO3 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_70782 http://purl.obolibrary.org/obo/CHEBI_35821 |
|
| has_alternative_id |
CHEBI:73161 |
|
| has_exact_synonym |
Clofibric acid 2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(4-Chlorophenoxy)-2-methylpropionic acid Chlorophibrinic acid acidum clofibricum alpha-(p-chlorophenoxy)isobutyric acid 2-(p-Chlorophenoxy)-2-methylpropionic acid Clofibrate free acid Clofibrinsaeure acido clofibrico Chlorfibrinic acid 2-(p-Chlorophenoxy)isobutyric acid Chlorofibrinic acid acide clofibrique alpha-(4-chlorophenoxy)-alpha-methylpropionic acid Acide (p-chlorophenoxy)-2 methyl-2 propionique clofibric acid 4-CPIB CPIB PCIB PCPIB |
|
| id |
CHEBI:34648 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) |
|
| inchikey |
TXCGAZHTZHNUAI-UHFFFAOYSA-N |
|
| label |
clofibric acid |
|
| mass |
214.64524 |
|
| monoisotopicmass |
214.03967 |
|
| notation |
CHEBI:34648 |
|
| prefLabel |
clofibric acid |
|
| smiles |
CC(C)(Oc1ccc(Cl)cc1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |