Preferred Name |
butoconazole |
|
Synonyms |
1-{4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl}-1H-imidazole Butoconazole butoconazole 1-[4-(4-Chloro-phenyl)-2-(2,6-dichloro-phenylsulfanyl)-butyl]-1H-imidazole butoconazol butoconazolum |
|
Definitions |
A member of the class of imidazoles that is 1H-imidazole in which the hydrogen attached to the nitrogen is substituted by a 4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl group. An antifungal agent, it is used as its nitrate salt in gynaecology for treatment of vulvovaginal infections caused by Candida species, particularly Candida albicans. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3240 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1344 DrugBank:DB00639 Drug_Central:450 Patent:US4078071 Beilstein:627151 CAS:64872-76-0 KEGG:C08065 Reaxys:627151 KEGG:D07598 Wikipedia:Butoconazole |
|
definition |
A member of the class of imidazoles that is 1H-imidazole in which the hydrogen attached to the nitrogen is substituted by a 4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl group. An antifungal agent, it is used as its nitrate salt in gynaecology for treatment of vulvovaginal infections caused by Candida species, particularly Candida albicans. |
|
formula |
C19H17Cl3N2S |
|
has_alternative_id |
CHEBI:355508 |
|
has_exact_synonym |
1-{4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl}-1H-imidazole Butoconazole |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
butoconazole 1-[4-(4-Chloro-phenyl)-2-(2,6-dichloro-phenylsulfanyl)-butyl]-1H-imidazole butoconazol butoconazolum |
|
has_RxCUI |
19884 |
|
id |
CHEBI:3240 |
|
in_subset | ||
inchi |
InChI=1S/C19H17Cl3N2S/c20-15-7-4-14(5-8-15)6-9-16(12-24-11-10-23-13-24)25-19-17(21)2-1-3-18(19)22/h1-5,7-8,10-11,13,16H,6,9,12H2 |
|
inchikey |
SWLMUYACZKCSHZ-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
butoconazole |
|
mass |
411.77600 |
|
monoisotopicmass |
410.01780 |
|
notation |
CHEBI:3240 |
|
prefLabel |
butoconazole |
|
smiles |
Clc1ccc(CCC(Cn2ccnc2)Sc2c(Cl)cccc2Cl)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 http://purl.obolibrary.org/obo/CHEBI_87069 http://purl.obolibrary.org/obo/CHEBI_35683 |