loading...| Preferred Name |
Nicorandil |
|
| Synonyms |
2-[(pyridin-3-ylcarbonyl)amino]ethyl nitrate nicorandilum 2-nicotinamidoethyl nitrate N-(2-hydroxyethyl)nicotinamide nitrate Adancor Ikorel Perisalol SG 75 SG-75 Sigmart nicorandil |
|
| Definitions |
A pyrimidinecarboxamide that is nicotinamide in which one of the hydrogens attached to the carboxamide nitrogen is replaced by a 2-(nitrooxy)ethyl group. It has both nitrate-like and ATP-sensitive potassium channel activator properties, and is used for the prevention and treatment of angina pectoris. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31905 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-6009 KEGG:D01810 Patent:US4200640 KEGG:C13280 PMID:23845070 PMID:25319832 CAS:65141-46-0 Drug_Central:1919 Wikipedia:Nicorandil PMID:24685703 Patent:DE2714713 PMID:23841868 PMID:24952900 PMID:24837014 |
|
| definition |
A pyrimidinecarboxamide that is nicotinamide in which one of the hydrogens attached to the carboxamide nitrogen is replaced by a 2-(nitrooxy)ethyl group. It has both nitrate-like and ATP-sensitive potassium channel activator properties, and is used for the prevention and treatment of angina pectoris. |
|
| formula |
C8H9N3O4 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
2-[(pyridin-3-ylcarbonyl)amino]ethyl nitrate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
nicorandilum 2-nicotinamidoethyl nitrate N-(2-hydroxyethyl)nicotinamide nitrate Adancor Ikorel Perisalol SG 75 SG-75 Sigmart nicorandil |
|
| has_RxCUI |
31748 |
|
| id |
CHEBI:31905 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H9N3O4/c12-8(7-2-1-3-9-6-7)10-4-5-15-11(13)14/h1-3,6H,4-5H2,(H,10,12) |
|
| inchikey |
LBHIOVVIQHSOQN-UHFFFAOYSA-N |
|
| label |
Nicorandil nicorandil |
|
| mass |
211.17480 |
|
| monoisotopicmass |
211.05931 |
|
| notation |
CHEBI:31905 |
|
| prefLabel |
Nicorandil |
|
| smiles |
[O-][N+](=O)OCCNC(=O)c1cccnc1 |
|
| subClassOf |