Preferred Name |
profenamine |
|
Synonyms |
N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine 2-diethylamino-1-propyl-N-dibenzoparathiazine profenamina profenamine ethopropazine profenaminum 10-(2-diethylaminopropyl)phenothiazine 10-[2-(diethylamino)-2-methylethyl]phenothiazine N,N-diethyl-alpha-methyl-10H-phenothiazine-10-ethanamine 10-[2-(diethylamino)-1-propyl]phenothiazine N,N-diethyl-1-(10H-phenothiazin-10-yl)-2-propanamine 10-[2-(diethylamino)propyl]phenothiazine |
|
Definitions |
A member of the class of phenothiazines that is phenothiazine in which the hydrogen attached to the nitrogen is substituted by a 2-(diethylamino)propyl group. An antimuscarinic, it is used as the hydrochloride for the symptomatic treatment of Parkinson's disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_313639 |
|
charge |
0 |
|
database_cross_reference |
PMID:6539933 Drug_Central:1086 Wikipedia:Ethopropazine KEGG:D08426 PMID:17459789 Reaxys:89828 Patent:US2607773 DrugBank:DB00392 CAS:522-00-9 HMDB:HMDB0014536 LINCS:LSM-1342 |
|
definition |
A member of the class of phenothiazines that is phenothiazine in which the hydrogen attached to the nitrogen is substituted by a 2-(diethylamino)propyl group. An antimuscarinic, it is used as the hydrochloride for the symptomatic treatment of Parkinson's disease. |
|
formula |
C19H24N2S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37887 http://purl.obolibrary.org/obo/CHEBI_37956 |
|
has_exact_synonym |
N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-diethylamino-1-propyl-N-dibenzoparathiazine profenamina profenamine ethopropazine profenaminum 10-(2-diethylaminopropyl)phenothiazine 10-[2-(diethylamino)-2-methylethyl]phenothiazine N,N-diethyl-alpha-methyl-10H-phenothiazine-10-ethanamine 10-[2-(diethylamino)-1-propyl]phenothiazine N,N-diethyl-1-(10H-phenothiazin-10-yl)-2-propanamine 10-[2-(diethylamino)propyl]phenothiazine |
|
has_RxCUI |
4134 |
|
id |
CHEBI:313639 |
|
in_subset | ||
inchi |
InChI=1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
|
inchikey |
CDOZDBSBBXSXLB-UHFFFAOYSA-N |
|
label |
profenamine |
|
mass |
312.47200 |
|
monoisotopicmass |
312.16602 |
|
notation |
CHEBI:313639 |
|
prefLabel |
profenamine |
|
smiles |
CCN(CC)C(C)CN1c2ccccc2Sc2ccccc12 |
|
subClassOf |