loading...| Preferred Name |
fluorene |
|
| Synonyms |
9H-fluorene Fluorene fluorene 2,2'-Methylenebiphenyl Diphenylenemethane o-biphenylmethane 2,3-benzindene o-biphenylenemethane Fluoren |
|
| Definitions |
An ortho-fused tricyclic hydrocarbon that is a major component of fossil fuels and their derivatives |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28266 |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:FLUORENE UM-BBD_compID:c0388 PMID:23202077 CAS:86-73-7 PMID:17129129 PMID:17285163 PMID:21110374 PMID:28409789 PMID:15800860 Wikipedia:Fluorene PMID:17243671 FooDB:FDB007671 PMID:24584240 Gmelin:28451 PMID:21478643 Beilstein:1363491 Reaxys:1363491 PMID:19060398 KEGG:C07715 PMID:24889657 PMID:16539455 PMID:17824593 PDBeChem:9FL Chemspider:6592 PMID:15120562 |
|
| definition |
An ortho-fused tricyclic hydrocarbon that is a major component of fossil fuels and their derivatives |
|
| formula |
C13H10 |
|
| has_alternative_id |
CHEBI:24058 CHEBI:5112 |
|
| has_exact_synonym |
9H-fluorene Fluorene fluorene |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2,2'-Methylenebiphenyl Diphenylenemethane o-biphenylmethane 2,3-benzindene o-biphenylenemethane Fluoren |
|
| id |
CHEBI:28266 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
|
| inchikey |
NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
|
| label |
fluorene |
|
| mass |
166.223 |
|
| monoisotopicmass |
166.07825 |
|
| notation |
CHEBI:28266 |
|
| prefLabel |
fluorene |
|
| smiles |
C1C2=CC=CC=C2C2=CC=CC=C12 |
|
| subClassOf |