Preferred Name |
resveratrol |
|
Synonyms |
Resveratrol 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol 3,4',5-Trihydroxystilbene |
|
Definitions |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27881 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C03582 Beilstein:1912433 PMID:12939617 CAS:501-36-0 LINCS:LSM-2557 DrugBank:DB02709 PMID:16461283 |
|
definition |
A stilbenol that is stilbene in which the phenyl groups are substituted at positions 3, 5, and 4' by hydroxy groups. |
|
formula |
C14H12O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
has_alternative_id |
CHEBI:19867 CHEBI:11685 CHEBI:1366 |
|
has_exact_synonym |
Resveratrol 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3,4',5-Trihydroxystilbene |
|
has_RxCUI |
1000492 |
|
id |
CHEBI:27881 |
|
in_subset | ||
inchi |
InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H |
|
inchikey |
LUKBXSAWLPMMSZ-UHFFFAOYSA-N |
|
label |
resveratrol |
|
mass |
228.24328 |
|
monoisotopicmass |
228.07864 |
|
notation |
CHEBI:27881 |
|
prefLabel |
resveratrol |
|
smiles |
[H]C(=C([H])c1cc(O)cc(O)c1)c1ccc(O)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33572 |