loading...| Preferred Name | griseofulvin | |
| Synonyms |
(+)-griseofulvin Spirofulvin griseofulvin griseofulvina griseofulvine Sporostatin Curling factor griseofulvinum Fulcin Fulvicin Grifulvin Grisactin Grisovin Grysio Lamoryl Likuden Poncyl amudane (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione Griseofulvin |
|
| Definitions |
An oxaspiro compound produced by Penicillium griseofulvum. It is used by mouth as an antifungal drug for infections involving the scalp, hair, nails and skin that do not respond to topical treatment. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27779 |
|
| alternative label |
(+)-griseofulvin Spirofulvin griseofulvin griseofulvina griseofulvine Sporostatin Curling factor griseofulvinum Fulcin Fulvicin Grifulvin Grisactin Grisovin Grysio Lamoryl Likuden Poncyl amudane (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione Griseofulvin |
|
| charge |
0 |
|
| database_cross_reference |
MetaCyc:CPD-17786 CAS:126-07-8 PMID:16922553 Reaxys:95226 LINCS:LSM-5259 KEGG:C06686 Drug_Central:1331 PMID:3277037 PMID:14407521 KNApSAcK:C00002398 Beilstein:95226 Patent:US3069329 KEGG:D00209 Patent:US3069328 PMID:23111828 DrugBank:DB00400 PMID:25476923 PMID:15078340 Wikipedia:Griseofulvin LIPID_MAPS_instance:LMPK13060001 PPDB:1807 VSDB:1807 |
|
| definition |
An oxaspiro compound produced by Penicillium griseofulvum. It is used by mouth as an antifungal drug for infections involving the scalp, hair, nails and skin that do not respond to topical treatment. |
|
| formula |
C17H17ClO6 |
|
| has role | ||
| has_alternative_id |
CHEBI:24429 CHEBI:5546 |
|
| has_exact_synonym |
griseofulvin (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione Griseofulvin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-griseofulvin Spirofulvin griseofulvin griseofulvina griseofulvine Sporostatin Curling factor griseofulvinum Fulcin Fulvicin Grifulvin Grisactin Grisovin Grysio Lamoryl Likuden Poncyl amudane |
|
| has_RxCUI |
5021 |
|
| id |
CHEBI:27779 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17+/m1/s1 |
|
| inchikey |
DDUHZTYCFQRHIY-RBHXEPJQSA-N |
|
| label |
griseofulvin |
|
| mass |
352.76598 |
|
| monoisotopicmass |
352.07137 |
|
| notation |
CHEBI:27779 |
|
| prefLabel |
griseofulvin |
|
| smiles |
COc1cc(OC)c2C(=O)[C@]3(Oc2c1Cl)[C@H](C)CC(=O)C=C3OC |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38830 http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_87128 |