Preferred Name |
amobarbital |
|
Synonyms |
5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione Amobarbital 5-ethyl-5-isoamylbarbituric acid amylobarbitone 5-ethyl-5-isopentylbarbituric acid 5-ethyl-5-(3-methylbutyl)barbituric acid 5-ethyl-5-(3-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione amytal barbamil barbamyl |
|
Definitions |
A member of the class of barbiturates that is pyrimidine-2,4,6(1H,3H,5H)-trione substituted by a 3-methylbutyl and an ethyl group at position 5. Amobarbital has been shown to exhibit sedative and hypnotic properties. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2673 |
|
charge |
0 |
|
database_cross_reference |
CAS:57-43-2 KEGG:D00555 Drug_Central:184 HMDB:HMDB0015440 Gmelin:281708 Reaxys:211172 Beilstein:211172 Patent:US3507960 DrugBank:DB01351 KEGG:C07536 Wikipedia:Amobarbital MetaCyc:CPD-5742 |
|
definition |
A member of the class of barbiturates that is pyrimidine-2,4,6(1H,3H,5H)-trione substituted by a 3-methylbutyl and an ethyl group at position 5. Amobarbital has been shown to exhibit sedative and hypnotic properties. |
|
formula |
C11H18N2O3 |
|
has_exact_synonym |
5-ethyl-5-(3-methylbutyl)pyrimidine-2,4,6(1H,3H,5H)-trione Amobarbital |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-ethyl-5-isoamylbarbituric acid amylobarbitone 5-ethyl-5-isopentylbarbituric acid 5-ethyl-5-(3-methylbutyl)barbituric acid 5-ethyl-5-(3-methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione amytal barbamil barbamyl |
|
has_RxCUI |
719 |
|
id |
CHEBI:2673 |
|
in_subset | ||
inchi |
InChI=1S/C11H18N2O3/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
|
inchikey |
VIROVYVQCGLCII-UHFFFAOYSA-N |
|
label |
amobarbital Amobarbital |
|
mass |
226.27230 |
|
monoisotopicmass |
226.13174 |
|
notation |
CHEBI:2673 |
|
prefLabel |
amobarbital |
|
smiles |
CCC1(CCC(C)C)C(=O)NC(=O)NC1=O |
|
subClassOf |