loading...| Preferred Name | amantadine | |
| Synonyms |
tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1(3,7)]decan-1-amine 1-aminoadamantane tricyclo[3.3.1.1(3,7)]decan-1-ylamine amantadinum 1-adamantylamine Aminoadamantane 1-adamantanamine Amantidine Viregyt Virosol amantadina amantadine adamantan-1-ylamine Amantadine |
|
| Definitions |
A member of the class of adamantanes that is used as an antiviral and antiparkinson drug. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2618 |
|
| alternative label |
tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1(3,7)]decan-1-amine 1-aminoadamantane tricyclo[3.3.1.1(3,7)]decan-1-ylamine amantadinum 1-adamantylamine Aminoadamantane 1-adamantanamine Amantidine Viregyt Virosol amantadina amantadine adamantan-1-ylamine Amantadine |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06818 CAS:768-94-5 Drug_Central:144 PMID:24427376 Wikipedia:Amantadine PMID:23011311 DrugBank:DB00915 PMID:24371305 Reaxys:2204333 KEGG:D07441 Gmelin:27066 Beilstein:2204333 VSDB:2961 |
|
| definition |
A member of the class of adamantanes that is used as an antiviral and antiparkinson drug. |
|
| formula |
C10H17N |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_36044 http://purl.obolibrary.org/obo/CHEBI_60643 |
|
| has_exact_synonym |
adamantan-1-ylamine Amantadine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1(3,7)]decan-1-amine 1-aminoadamantane tricyclo[3.3.1.1(3,7)]decan-1-ylamine amantadinum 1-adamantylamine Aminoadamantane 1-adamantanamine Amantidine Viregyt Virosol amantadina amantadine |
|
| has_RxCUI |
620 |
|
| id |
CHEBI:2618 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2 |
|
| inchikey |
DKNWSYNQZKUICI-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
amantadine |
|
| mass |
151.24870 |
|
| monoisotopicmass |
151.13610 |
|
| notation |
CHEBI:2618 |
|
| prefLabel |
amantadine |
|
| smiles |
NC12CC3CC(CC(C3)C1)C2 |
|
| subClassOf |