Preferred Name |
Alfentanil |
|
Synonyms |
N-{1-[2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-4-yl}-N-phenylpropanamide N-(1-(2-(4-Ethyl-5-oxo-2-tetrazolin-1-yl)ethyl)-4-(methoxymethyl)-4-piperidyl)propionanilide alfentanilum Alfentanyl alfentanil |
|
Definitions |
A member of the class of piperidines that is piperidine having a 2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl group at the 1-position as well as N-phenylpropanamido- and methoxymethyl groups at the 4-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2569 |
|
charge |
0 |
|
database_cross_reference |
PMID:16621415 DrugBank:DB00802 Beilstein:1188293 PMID:11240593 Patent:US2014005223 CAS:71195-58-9 PMID:23446076 Wikipedia:Alfentanil HMDB:HMDB0014940 Drug_Central:114 KEGG:D07122 Patent:US4167574 PMID:11999595 KEGG:C08005 Patent:DE2819873 Reaxys:1188293 |
|
definition |
A member of the class of piperidines that is piperidine having a 2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl group at the 1-position as well as N-phenylpropanamido- and methoxymethyl groups at the 4-position. |
|
formula |
C21H32N6O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_49110 http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_55322 |
|
has_exact_synonym |
N-{1-[2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl]-4-(methoxymethyl)piperidin-4-yl}-N-phenylpropanamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-(1-(2-(4-Ethyl-5-oxo-2-tetrazolin-1-yl)ethyl)-4-(methoxymethyl)-4-piperidyl)propionanilide alfentanilum Alfentanyl alfentanil |
|
has_RxCUI |
480 |
|
id |
CHEBI:2569 |
|
in_subset | ||
inchi |
InChI=1S/C21H32N6O3/c1-4-19(28)27(18-9-7-6-8-10-18)21(17-30-3)11-13-24(14-12-21)15-16-26-20(29)25(5-2)22-23-26/h6-10H,4-5,11-17H2,1-3H3 |
|
inchikey |
IDBPHNDTYPBSNI-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
Alfentanil alfentanil |
|
mass |
416.51720 |
|
monoisotopicmass |
416.25359 |
|
notation |
CHEBI:2569 |
|
prefLabel |
Alfentanil |
|
smiles |
CCC(=O)N(c1ccccc1)C1(CCN(CCn2nnn(CC)c2=O)CC1)COC |
|
subClassOf |