Preferred Name |
lipoic acid |
|
Synonyms |
Lipoic acid 5-(1,2-dithiolan-3-yl)pentanoic acid alpha-Liponsaeure alpha-Lipoic acid 5-(dithiolan-3-yl)valeric acid Thioctansaeure Acetate-replacing factor Thioktsaeure 6,8-thiotic acid alpha-lipoic acid 1,2-dithiolane-3-pentanoic acid 5-(1,2-dithiolan-3-yl)valeric acid 6-thiotic acid liponic acid 5-[3-(1,2-dithiolanyl)]pentanoic acid 6,8-thioctic acid 6-thioctic acid Thioctic acid 1,2-dithiolane-3-valeric acid Thioctsaeure Biletan |
|
Definitions |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16494 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:122410 Drug_Central:4732 KEGG:D00086 Wikipedia:Lipoic_acid DrugBank:DB00166 YMDB:YMDB00334 Beilstein:81853 CAS:62-46-4 PMID:7519986 KEGG:C00725 PMID:15328413 PMID:7548757 ECMDB:ECMDB01451 Gmelin:720915 Reaxys:81853 |
|
definition |
A heterocyclic thia fatty acid comprising pentanoic acid with a 1,2-dithiolan-3-yl group at the 5-position. |
|
formula |
C8H14O2S2 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:25058 CHEBI:146958 CHEBI:6492 |
|
has_exact_synonym |
Lipoic acid 5-(1,2-dithiolan-3-yl)pentanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
alpha-Liponsaeure alpha-Lipoic acid 5-(dithiolan-3-yl)valeric acid Thioctansaeure Acetate-replacing factor Thioktsaeure 6,8-thiotic acid alpha-lipoic acid 1,2-dithiolane-3-pentanoic acid 5-(1,2-dithiolan-3-yl)valeric acid 6-thiotic acid liponic acid 5-[3-(1,2-dithiolanyl)]pentanoic acid 6,8-thioctic acid 6-thioctic acid Thioctic acid 1,2-dithiolane-3-valeric acid Thioctsaeure Biletan |
|
id |
CHEBI:16494 |
|
in_subset | ||
inchi |
InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) |
|
inchikey |
AGBQKNBQESQNJD-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
lipoic acid |
|
mass |
206.32756 |
|
monoisotopicmass |
206.04352 |
|
notation |
CHEBI:16494 |
|
prefLabel |
lipoic acid |
|
smiles |
OC(=O)CCCCC1CCSS1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_39192 |