Preferred Name |
magnesium citrate |
|
Synonyms |
magnesium 3-carboxy-3-hydroxypentanedioate Magnesium hydrogen citrate Magnesium citrate dibasic E345 |
|
Definitions |
A magnesium salt composed of magnesium and dibasic citrate ions in a 1:1 ratio. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_131389 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Magnesium_citrate PMID:26818765 PMID:26751113 PMID:26272858 Reaxys:15570024 CAS:144-23-0 PMID:26886637 |
|
definition |
A magnesium salt composed of magnesium and dibasic citrate ions in a 1:1 ratio. |
|
formula |
C6H6MgO7 |
|
has part | ||
has role | ||
has_exact_synonym |
magnesium 3-carboxy-3-hydroxypentanedioate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Magnesium hydrogen citrate Magnesium citrate dibasic E345 |
|
has_RxCUI |
52356 |
|
id |
CHEBI:131389 |
|
in_subset | ||
inchi |
InChI=1S/C6H8O7.Mg/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
|
inchikey |
DIXGJWCZQHXZNR-UHFFFAOYSA-L |
|
label |
magnesium citrate |
|
mass |
214.413 |
|
monoisotopicmass |
213.99639 |
|
notation |
CHEBI:131389 |
|
prefLabel |
magnesium citrate |
|
smiles |
C(CC([O-])=O)(O)(CC([O-])=O)C(O)=O.[Mg+2] |
|
subClassOf |