loading...| Preferred Name | zileuton | |
| Synonyms |
(+-)-1-(1-Benzo[b]thien-2-ylethyl)-1-hydroxyurea N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea N-[1-(benzo[b]thiophen-2-yl)ethyl]-N-hydroxyurea Leutrol Zyflo zileuton zileutonum 1-[1-(1-benzothien-2-yl)ethyl]-1-hydroxyurea Zileuton |
|
| Definitions |
A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogen at position 2 is replaced by a 1-[carbamoyl(hydroxy)amino]ethyl group. A selective 5-lipoxygenase inhibitor, it inhibits the formation of leukotrienes LTB4, LTC4, LDT4, and LTE4. It is used for the management of chronic asthma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10112 |
|
| alternative label |
(+-)-1-(1-Benzo[b]thien-2-ylethyl)-1-hydroxyurea N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea N-[1-(benzo[b]thiophen-2-yl)ethyl]-N-hydroxyurea Leutrol Zyflo zileuton zileutonum 1-[1-(1-benzothien-2-yl)ethyl]-1-hydroxyurea Zileuton |
|
| charge |
0 |
|
| database_cross_reference |
PMID:19645854 PMID:20204486 DrugBank:DB00744 Wikipedia:Zileuton LINCS:LSM-5084 KEGG:D00414 Drug_Central:2862 PMID:19309543 Reaxys:4869674 CAS:111406-87-2 PMID:20436887 |
|
| definition |
A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogen at position 2 is replaced by a 1-[carbamoyl(hydroxy)amino]ethyl group. A selective 5-lipoxygenase inhibitor, it inhibits the formation of leukotrienes LTB4, LTC4, LDT4, and LTE4. It is used for the management of chronic asthma. |
|
| formula |
C11H12N2O2S |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_64964 http://purl.obolibrary.org/obo/CHEBI_49159 http://purl.obolibrary.org/obo/CHEBI_173084 |
|
| has_exact_synonym |
1-[1-(1-benzothien-2-yl)ethyl]-1-hydroxyurea Zileuton |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+-)-1-(1-Benzo[b]thien-2-ylethyl)-1-hydroxyurea N-(1-Benzo(b)thien-2-ylethyl)-N-hydroxyurea N-[1-(benzo[b]thiophen-2-yl)ethyl]-N-hydroxyurea Leutrol Zyflo zileuton zileutonum |
|
| has_RxCUI |
40575 |
|
| id |
CHEBI:10112 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H12N2O2S/c1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h2-7,15H,1H3,(H2,12,14) |
|
| inchikey |
MWLSOWXNZPKENC-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
zileuton |
|
| mass |
236.29126 |
|
| monoisotopicmass |
236.06195 |
|
| notation |
CHEBI:10112 |
|
| prefLabel |
zileuton |
|
| smiles |
CC(N(O)C(N)=O)c1cc2ccccc2s1 |
|
| subClassOf |